|
|
| | (R)-1-Boc-3-Hydroxypiperidine Basic information |
| Product Name: | (R)-1-Boc-3-Hydroxypiperidine | | Synonyms: | (R)-1-Boc-3-hydroxypiperidine 95%;tert-Butyl (3R)-3-hydroxypiperidine-1-carboxylate, (3R)-1-(tert-Butoxycarbonyl)-3-hydroxypiperidine;tert- butyl (R)-3-hydroxy piperidine-1-carboxylate;(R)-1-Boc-3-hydroxypiperidine,97%;(R)-1-N-BOC-3-HYDROXYPIPERIDINE;(R)-1-BOC-3-PIPERIDINOL;(R)-1-BOC-3-HYDROXYPIPERIDINE;R-3-HYDROXY-1-(TERT-BUTOXYCARBONYL)PIPERIDINE | | CAS: | 143900-43-0 | | MF: | C10H19NO3 | | MW: | 201.26 | | EINECS: | | | Product Categories: | Ibrutinib intermediate;Piperazine;Piperidines;Piperidine | | Mol File: | 143900-43-0.mol |  |
| | (R)-1-Boc-3-Hydroxypiperidine Chemical Properties |
| Melting point | 43-50 °C | | Boiling point | 292.3±33.0 °C(Predicted) | | density | 1.107±0.06 g/cm3(Predicted) | | Fp | 104°C | | storage temp. | 2-8°C | | solubility | soluble in Methanol | | pka | 14.74±0.20(Predicted) | | form | Low Melting Solid | | color | White to tan | | Optical Rotation | [α]/D 22±3°, c = 5 in methanol | | InChI | InChI=1S/C10H19NO3/c1-10(2,3)14-9(13)11-6-4-5-8(12)7-11/h8,12H,4-7H2,1-3H3/t8-/m1/s1 | | InChIKey | UIJXHKXIOCDSEB-MRVPVSSYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCC[C@@H](O)C1 | | CAS DataBase Reference | 143900-43-0(CAS DataBase Reference) |
| Hazard Codes | T | | Risk Statements | 36/37/38-41-37/38-25 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | HazardClass | 6.1 | | PackingGroup | Ⅲ | | HS Code | 29333990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| | (R)-1-Boc-3-Hydroxypiperidine Usage And Synthesis |
| Chemical Properties | White powder | | Uses | (R)-1-Boc-3-hydroxypiperidine has been used as a reactant for the synthesis of piperidinyl and pyrrolidinyl butyrates. It has also been used for the synthesis of constrained (-)-S-adenosyl-L-homocysteine (SAH) analogs as DNA methyltransferase inhibitors. | | Synthesis | A suspension of (3R)-piperidin-3-ol hydrochloride (3.17 g, 0.023 mol) in CH2Cl2 (40 mL) was treated with Na2CO3 (5.13 g, 0) dissolved in H2O (80 mL)
0.048 mol) and then treated with diiron dicarbonate/fluorobutyl ester (5.53 g, 0.025 mol) and additional CH2Cl3 (24 mL). The resulting mixture was stirred for 21 hours. The layers were separated and the aqueous phase was extracted with CH2Cl2 (3x50)
mL) to extract the aqueous phase. The combined organic layers were dried with Na2SO4, filtered, and concentrated in vacuo. The residue was analyzed by column chromatography (9:1
CH2Cl2:MeOH) purification to give colorless oily (R)-1-Boc-3-hydroxypiperidine (5.07 g, quantitative). Mass spectrum (M+1): 202.0. 1H NMR (400 MHz, chloroform-D) ppm of 1.40-1.56 (M, 2h), 1.44 (s, 9h), 1.67-1.80 (M, 1H), 1.80-1.93 (M, 1
H), 2.95-3.22 (M, 2h), 3.47 (D, J=5.1 Hz, 1H), 3.51 (brs, 1H) and 3.64-3.78 (M, 2 H). |
| | (R)-1-Boc-3-Hydroxypiperidine Preparation Products And Raw materials |
|