|
|
| | 2-Chloro-1,3-bis(dimentylamino)trimethinium hexafluorophosphate Basic information |
| Product Name: | 2-Chloro-1,3-bis(dimentylamino)trimethinium hexafluorophosphate | | Synonyms: | 2-CHLORO-1,3-BIS(DIMENTYLAMINO)TRIMETHINIUM HEXAFLUOROPHOSPHATE (VINAMIDINIUM SALTS);2-CHLORO-1,3-BIS(DIMENTYLAMINO)TRIMETHINIUM HEXAFLUOROPHOSPHATE;2-Chloro-1,3-bis(dimentylamino)trimrthinium hexafluorophosphate;2-CHLORO-1 3-BIS(DIMENTHYLAMINO)TRIMETHI NIUM HEXAFLUOROPHOSPHATE;(Z)-N-(2-chloro-3-(dimethylamino)allylidene);Etoricoxib Related Compound C
(2-Chloro-1,3-bis(dimethylamino)trimethinium Hexafluorophosphate);N,N-DiMethyl-2-chloro-triMethiniuM Hexafluorophosphate;Etoricoxib Related CoMpound C | | CAS: | 249561-98-6 | | MF: | C7H14ClF6N2P | | MW: | 306.62 | | EINECS: | 619-785-1 | | Product Categories: | | | Mol File: | 249561-98-6.mol |  |
| | 2-Chloro-1,3-bis(dimentylamino)trimethinium hexafluorophosphate Chemical Properties |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Pale Yellow | | InChI | InChI=1S/C7H14ClN2.F6P/c1-9(2)5-7(8)6-10(3)4;1-7(2,3,4,5)6/h5-6H,1-4H3;/q+1;-1 | | InChIKey | PIUHAULDXSPPQV-UHFFFAOYSA-N | | SMILES | [P+5]([F-])([F-])([F-])([F-])([F-])[F-].C(=[N+](/C)\C)/C(Cl)=CN(C)C |
| | 2-Chloro-1,3-bis(dimentylamino)trimethinium hexafluorophosphate Usage And Synthesis |
| Uses | N-[2-Chloro-3-(dimethylamino)-2-propen-1-ylidene]-N-methylmethanaminium Hexafluorophosphate is used in the preparation of etoricoxib (E934100). N-[2-Chloro-3-(dimethylamino)-2-propen-1-ylidene]-N-methylmethanaminium Hexafluorophosphate is a thermally shock stable and non-hygroscopic solid. | | Hazard |
2-Chloro-1,3-bis(dimentylamino)trimethinium hexafluorophosphate has acute oral toxicity and acute inhalation toxicity, it causes skin corrosion/irritation and serious eye damage/eye irritation.
|
| | 2-Chloro-1,3-bis(dimentylamino)trimethinium hexafluorophosphate Preparation Products And Raw materials |
|