- Lauroyl Lysine
-
- $0.00 / 1kg
-
2026-02-11
- CAS:52315-75-0
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 20MT
- N'-Laruoyl-L-lysine
-
- $0.00 / 1KG
-
2026-02-07
- CAS:52315-75-0
- Min. Order: 0.0001KG
- Purity: 99%
- Supply Ability: 2000000t
- Lauroyl lysine
-
- $29.00 / 500mg
-
2026-01-15
- CAS:52315-75-0
- Min. Order:
- Purity: 99.18%
- Supply Ability: 10g
|
| | N'-Laruoyl-L-lysine Basic information |
| Product Name: | N'-Laruoyl-L-lysine | | Synonyms: | N-LAUROYL-L-LYSINE;N-ALPHA-LAUROYL-L-LYSINE;lauroyllysine;n6-(1-oxododecyl)-l-lysin;N-6-(1-oxododecyl)-L-Lysine;N-6-Lauroyl-L-lysine;L-Lysine, N6-(1-oxododecyl)-;N''-LARUOYL-L-LYSINE | | CAS: | 52315-75-0 | | MF: | C18H36N2O3 | | MW: | 328.49 | | EINECS: | 257-843-4 | | Product Categories: | | | Mol File: | 52315-75-0.mol |  |
| | N'-Laruoyl-L-lysine Chemical Properties |
| Melting point | 229-231 °C | | Boiling point | 528.0±45.0 °C(Predicted) | | density | 0.994±0.06 g/cm3(Predicted) | | vapor pressure | 0-0Pa at 20-50℃ | | storage temp. | 2-8°C | | pka | 2.53±0.24(Predicted) | | form | Powder | | color | White to off-white | | Cosmetics Ingredients Functions | HAIR CONDITIONING
VISCOSITY CONTROLLING
SKIN CONDITIONING | | Cosmetic Ingredient Review (CIR) | N'-Laruoyl-L-lysine (52315-75-0) | | InChI | InChI=1S/C18H36N2O3/c1-2-3-4-5-6-7-8-9-10-14-17(21)20-15-12-11-13-16(19)18(22)23/h16H,2-15,19H2,1H3,(H,20,21)(H,22,23)/t16-/m0/s1 | | InChIKey | GYDYJUYZBRGMCC-INIZCTEOSA-N | | SMILES | C(O)(=O)[C@H](CCCCNC(=O)CCCCCCCCCCC)N | | LogP | 1.9 at 20℃ and pH6.4 | | EPA Substance Registry System | Lauroyl lysine (52315-75-0) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 3-10 | | TSCA | TSCA listed |
| | N'-Laruoyl-L-lysine Usage And Synthesis |
| Chemical Properties | N-(Dodecanoyl)lysine is unique in its chemical structure. The lysine portion of its molecule gives it its basic properties as an amino acid derivative, while the dodecanoyl group gives it its unique fatty chain structure. This structure makes N-(dodecanoyl)lysine unique in terms of both biological activity and chemical properties. | | Uses | Lauroyl lysine (N6-Lauroyl-L-lysine) is a compound that can be synthesized by recombinant enzymes. After the synthase is cloned and expressed, it can be used to synthesize lauroyl lysine from specific raw materials with high yield. | | Application | N-Lauroyl-L-lysine is a useful research chemical. | | References | [1] Efficient Nepsilon-lauroyl-L-lysine production by recombinant epsilon-lysine acylase from Streptomyces mobaraensis DOI:10.1016/j.jbiotec.2009.03.008 |
| | N'-Laruoyl-L-lysine Preparation Products And Raw materials |
|