|
|
| | 1H-1,2,3-Triazole-5-carboxylicacid,1-methyl-,methylester(9CI) Basic information |
| Product Name: | 1H-1,2,3-Triazole-5-carboxylicacid,1-methyl-,methylester(9CI) | | Synonyms: | 1H-1,2,3-Triazole-5-carboxylicacid,1-methyl-,methylester(9CI);Methyl 1-Methyl-1,2,3-triazole-5-carboxylate;1-methyl-1H-1,2,3-Triazole-5-carboxylic acid methyl ester;Methyl 1-methyl-1H-1,2,3-triazole-5-carboxylate;1H-1,2,3-Triazole-5-carboxylic acid, 1-methyl-, methyl ester | | CAS: | 105020-38-0 | | MF: | C5H7N3O2 | | MW: | 141.13 | | EINECS: | | | Product Categories: | CARBOXYLICESTER | | Mol File: | 105020-38-0.mol |  |
| | 1H-1,2,3-Triazole-5-carboxylicacid,1-methyl-,methylester(9CI) Chemical Properties |
| storage temp. | Storage temp. 2-8°C | | Appearance | White to off-white Solid | | InChI | InChI=1S/C5H7N3O2/c1-8-4(3-6-7-8)5(9)10-2/h3H,1-2H3 | | InChIKey | FYMBUAMMFZJMJG-UHFFFAOYSA-N | | SMILES | N1(C)C(C(OC)=O)=CN=N1 |
| | 1H-1,2,3-Triazole-5-carboxylicacid,1-methyl-,methylester(9CI) Usage And Synthesis |
| Uses | Methyl 1-Methyl-1,2,3-triazole-5-carboxylate (cas# 105020-38-0) is used as a reagent in the composition and method for treating cognitive impairments in Down syndrome subjects. |
| | 1H-1,2,3-Triazole-5-carboxylicacid,1-methyl-,methylester(9CI) Preparation Products And Raw materials |
|