|
|
| | 1,3:2,4-Di-p-methylbenzylidene sorbitol Basic information |
| Product Name: | 1,3:2,4-Di-p-methylbenzylidene sorbitol | | Synonyms: | 1,3:2,4-di-p-methylbenyliedene sorbitol;IRGACLEAR DM;Nucleating Agent 3940;Thaclear 3940;IgraclearDM;D-Glucitol, bis-O-(4-methylphenyl)methylene-;DI(4-TOLYLIDENE)SORBITOL;(1,3:2,4)-DIPARAMETHYLDIBENZYLIDENE SORBITOL 98% | | CAS: | 54686-97-4 | | MF: | C22H26O6 | | MW: | 386.44 | | EINECS: | 611-185-8 | | Product Categories: | | | Mol File: | 54686-97-4.mol |  |
| | 1,3:2,4-Di-p-methylbenzylidene sorbitol Chemical Properties |
| Melting point | 255-262°C | | Water Solubility | <0.01 g/100 mL at 20 ºC | | InChI | InChI=1/C22H26O6/c1-13-3-7-15(8-4-13)21-25-12-18-20(28-21)19(17(24)11-23)27-22(26-18)16-9-5-14(2)6-10-16/h3-10,17-24H,11-12H2,1-2H3/t17-,18+,19-,20-,21,22/s3 | | InChIKey | LQAFKEDMOAMGAK-YYTYHAIYNA-N | | SMILES | [C@]12([H])[C@]([H])(COC(C3C=CC(C)=CC=3)O1)OC(C1C=CC(C)=CC=1)O[C@]2([H])[C@@H](CO)O |&1:0,2,25,27,r| |
| | 1,3:2,4-Di-p-methylbenzylidene sorbitol Usage And Synthesis |
| Uses | 1,3:2,4-Di-p-methylbenyliedene Sorbitol can be used for printing ink compositions and coating. |
| | 1,3:2,4-Di-p-methylbenzylidene sorbitol Preparation Products And Raw materials |
|