| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
3'-azido-3'-deoxyadenosine manufacturers
|
| | 3'-azido-3'-deoxyadenosine Basic information |
| | 3'-azido-3'-deoxyadenosine Chemical Properties |
| Melting point | 212-214 °C(Solv: water (7732-18-5)) | | form | Solid | | color | White to off-white | | InChI | InChI=1/C10H12N8O3/c11-8-6-9(14-2-13-8)18(3-15-6)10-7(20)5(16-17-12)4(1-19)21-10/h2-5,7,10,19-20H,1H2,(H2,11,13,14)/t4-,5-,7-,10-/s3 | | InChIKey | HTWSTKVLFZRAPM-RLCZZNSNNA-N | | SMILES | OC[C@H]1O[C@@H](N2C3=C(C(=NC=N3)N)N=C2)[C@H](O)[C@@H]1N=[N+]=[N-] |&1:2,4,15,17,r| |
| | 3'-azido-3'-deoxyadenosine Usage And Synthesis |
| Uses | 3′-Azido-3′-deoxyAdenosine is a useful research chemical compound used in the preparation and general synthesis of purine (amino, azido, and triflate)-sugar nucleosides. |
| | 3'-azido-3'-deoxyadenosine Preparation Products And Raw materials |
|