1-ACETYL-5-BROMOINDOLE manufacturers
- 1-ACETYL-5-BROMOINDOLE
-
- $1.00 / 1KG
-
2020-01-09
- CAS:61995-52-6
- Min. Order: 1KG
- Purity: 95--99%
- Supply Ability: 1ton
|
| | 1-ACETYL-5-BROMOINDOLE Basic information |
| Product Name: | 1-ACETYL-5-BROMOINDOLE | | Synonyms: | 1-ACETYL-5-BROMOINDOLE;1-ACETYL-5-BROMO-1H-INDOLE;1-(5-broMo-1H-indol-1-yl)ethan-1-one;Ethanone, 1-(5-bromo-1H-indol-1-yl)-;1-Acetyl-5-bromoindole,97%;1-(5-Bromoindol-1-yl)ethanone;1-Acetyl-5-bromo-1H-indole | | CAS: | 61995-52-6 | | MF: | C10H8BrNO | | MW: | 238.08 | | EINECS: | 200-258-5 | | Product Categories: | Indoles and derivatives | | Mol File: | 61995-52-6.mol |  |
| | 1-ACETYL-5-BROMOINDOLE Chemical Properties |
| storage temp. | 2-8°C | | form | Solid | | InChI | 1S/C10H8BrNO/c1-7(13)12-5-4-8-6-9(11)2-3-10(8)12/h2-6H,1H3 | | InChIKey | BOMKWHSZGCMFEG-UHFFFAOYSA-N | | SMILES | CC(N1C2=CC=C(Br)C=C2C=C1)=O |
| Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | 1-ACETYL-5-BROMOINDOLE Usage And Synthesis |
| | 1-ACETYL-5-BROMOINDOLE Preparation Products And Raw materials |
|