- Praeruptorin B
-
- $100.00
-
2025-12-22
- CAS:81740-07-0
- Purity: 99.96%
- Supply Ability: 10g
- Praeruptorin B
-
-
2024-04-12
- CAS:81740-07-0
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 2000ton
- Praeruptorin B
-
-
2023-02-24
- CAS:81740-07-0
- Min. Order: 5mg
- Purity: ≥98%(HPLC)
- Supply Ability: 10 g
|
| | Praeruptorin B Basic information |
| | Praeruptorin B Chemical Properties |
| Melting point | 179-181°C | | storage temp. | Amber Vial, -20°C Freezer, Under inert atmosphere | | solubility | Chloroform (Slightly), Methanol (Slightly, Heated) | | form | Solid | | color | Off-White | | Stability: | Light Sensitive | | InChI | InChI=1S/C24H26O7/c1-7-13(3)22(26)29-20-18-16(11-9-15-10-12-17(25)28-19(15)18)31-24(5,6)21(20)30-23(27)14(4)8-2/h7-12,20-21H,1-6H3/b13-7+,14-8+ | | InChIKey | PNTWXEIQXBRCPS-FNCQTZNRSA-N | | SMILES | C(OC1C2C3OC(=O)C=CC=3C=CC=2OC(C)(C)C1OC(=O)/C(/C)=C/C)(=O)/C(/C)=C/C |
| Safety Statements | 24/25 | | HS Code | 29389090 |
| | Praeruptorin B Usage And Synthesis |
| Chemical Properties | White crystals, easily soluble in methanol and ethyl acetate, almost insoluble in water, derived from Peucedanum peucedanum erectum. | | Uses | Praeruptorin B is a bioactive constituent of Peucedani Radix, a traditional Chinese medicinal herb used in the treatment of respiratory and pulmonary disorders. |
| | Praeruptorin B Preparation Products And Raw materials |
|