|
|
| | 3-(3,4-Dimethyl-benzenesulfonyl)-propionic acid Basic information |
| | 3-(3,4-Dimethyl-benzenesulfonyl)-propionic acid Chemical Properties |
| Boiling point | 480.6±45.0 °C(Predicted) | | density | 1.265±0.06 g/cm3(Predicted) | | form | solid | | pka | 3.80±0.10(Predicted) | | InChI | 1S/C11H14O4S/c1-8-3-4-10(7-9(8)2)16(14,15)6-5-11(12)13/h3-4,7H,5-6H2,1-2H3,(H,12,13) | | InChIKey | BQBZVJSVOQMDRC-UHFFFAOYSA-N | | SMILES | Cc1ccc(cc1C)S(=O)(=O)CCC(O)=O |
| Hazard Codes | Xi | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | 3-(3,4-Dimethyl-benzenesulfonyl)-propionic acid Usage And Synthesis |
| | 3-(3,4-Dimethyl-benzenesulfonyl)-propionic acid Preparation Products And Raw materials |
|