|
|
| | 5-BROMO-IMIDAZO[1,2-A]PYRIDINE Basic information |
| Product Name: | 5-BROMO-IMIDAZO[1,2-A]PYRIDINE | | Synonyms: | 5-BROMO-IMIDAZO[1,2-A]PYRIDINE;5-BROMOIMIDAZO[1,2-A]PYRIDINE, 95+%;5-bromoH-imidazo[1,2-a]pyridine;5-BROMO-5H-IMIDAZO[2,1-B][1,3]OXAZINE;5-Bromo-1,5-dihydroimidazo[1,2-a]pyridine;Imidazo[1,2-a]pyridine, 5-bromo-;5-Bromoimidazo[1,2-a]pyridine | | CAS: | 69214-09-1 | | MF: | C7H5BrN2 | | MW: | 197.03 | | EINECS: | 1592732-453-0 | | Product Categories: | API intermediates;Heterocycle-Pyridine series;Building Blocks;Imidazo[x,x-y]pyridine | | Mol File: | 69214-09-1.mol | ![5-BROMO-IMIDAZO[1,2-A]PYRIDINE Structure](CAS/GIF/69214-09-1.gif) |
| | 5-BROMO-IMIDAZO[1,2-A]PYRIDINE Chemical Properties |
| Melting point | 61-64℃ | | density | 1.69±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), DMSO (Slightly) | | pka | 5.15±0.50(Predicted) | | form | Solid | | color | Pale Brown to Light Brown | | InChI | InChI=1S/C7H5BrN2/c8-6-2-1-3-7-9-4-5-10(6)7/h1-5H | | InChIKey | CCOFGVWHMYYDBG-UHFFFAOYSA-N | | SMILES | C12=NC=CN1C(Br)=CC=C2 |
| WGK Germany | 3 | | HS Code | 2933599590 | | Storage Class | 11 - Combustible Solids |
| | 5-BROMO-IMIDAZO[1,2-A]PYRIDINE Usage And Synthesis |
| Uses | 5-Bromoimidazo[1,2-a]pyridine can be used as HPK1 antagonists to treat HPK1-mediated disorders. | | Synthesis | General procedure for the synthesis of 5-bromoimidazo[1,2-a]pyridines from 5-bromoimidazo[1,2-a]pyridine hydrobromide:
1. Preparation of reactants: 2-bromo-1,1-diethoxyethane (3.64 g, 18.48 mmol) was added to a solution of 6-bromopyridin-2-ylamine (1.0 g, 5.77 mmol) in n-butanol (40 mL).
2. Reaction conditions: the mixture was refluxed overnight and then cooled to room temperature.
3. post-processing: the reaction mixture was filtered to give 1.3 g (81% yield) of 5-bromoimidazo[1,2-a]pyridine hydrobromide as a white solid. esms (M + +1): 198.9 m/z.
4. Neutralization step: Saturated sodium bicarbonate solution (300 mL) was added to an ethyl acetate suspension of 5-bromoimidazo[1,2-a]pyridine hydrobromide (13.0 g, 46.96 mmol).
5. Isolation and purification: the organic layer was separated, washed with saturated sodium bicarbonate solution, dried with magnesium sulfate and concentrated under reduced pressure to give 9.7 g (100% yield) of 5-bromoimidazo[1,2-a]pyridine as a white solid. | | References | [1] Patent: WO2003/76398, 2003, A2. Location in patent: Page/Page column 20
[2] Patent: WO2003/76442, 2003, A1. Location in patent: Page/Page column 40 |
| | 5-BROMO-IMIDAZO[1,2-A]PYRIDINE Preparation Products And Raw materials |
|