- Sulfobetaine
-
- $10.00
-
2026-03-20
- CAS:4727-41-7
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10 mt
- Sulfobetaine
-
- $1.00
-
2025-12-12
- CAS:4727-41-7
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100000KG
|
| | Sulfobetaine Basic information |
| | Sulfobetaine Chemical Properties |
| Melting point | 241-242 °C(Solv: ethanol (64-17-5)) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Methanol (Slightly), Water (Slightly) | | form | Solid | | pka | 1.127±0.10(predicted) | | color | White to Off-White | | InChI | InChI=1S/C4H8O2S/c1-7(2)3-4(5)6/h3H2,1-2H3 | | InChIKey | PSBDWGZCVUAZQS-UHFFFAOYSA-N | | SMILES | C([O-])(=O)C[S+](C)C |
| | Sulfobetaine Usage And Synthesis |
| Uses | Sulfobetaine Hydrochloride is HCl form of Sulfobetaine (CAS 4727-41-7) which is a zwitterionic metabolite involved in the osmoadaption of phytoplankton. | | Definition | ChEBI: (dimethylsulfonio)acetate is a sulfonium betaine. It is a conjugate base of a (carboxymethyl)(dimethyl)sulfonium. |
| | Sulfobetaine Preparation Products And Raw materials |
|