|
|
| | (4S,5R)-(-)-4-METHYL-5-PHENYL-2-OXAZOLIDINONE Basic information |
| Product Name: | (4S,5R)-(-)-4-METHYL-5-PHENYL-2-OXAZOLIDINONE | | Synonyms: | (4S,5R)-(-)-4-METHYL-5-PHENYL-2-OXAZOLIDINONE;(4S,5R)-4-METHYL-5-PHENYL-2-OXAZOLIDINONE;(4S,5R)-(-)-4-METHYL-5-PHENYLOXAZOLIDIN-2-ONE;(4S,5R)-(-)-4-METHYL-5-PHENYL-2-OXAZOLID -INONE, 99% (99% EE/HPLC);2-Oxazolidinone, 4-methyl-5-phenyl-, (4S,5R)-;(4S,5R)-(-)-4-METHYL-5-PHENYLOXAZOLIDIN-2-ONE 99+%;(4S,5R)-(-)-4-Methyl-5-phenyl-2-oxazolidinone,99%;(4S,5R)-(-)-4-Methyl-2-oxo-5-phenyl-1,3-oxazolidine | | CAS: | 16251-45-9 | | MF: | C10H11NO2 | | MW: | 177.2 | | EINECS: | 202-303-5 | | Product Categories: | Peptide;Asymmetric Synthesis;Chiral Auxiliaries;Oxazolidinone Derivatives;API intermediates | | Mol File: | 16251-45-9.mol |  |
| | (4S,5R)-(-)-4-METHYL-5-PHENYL-2-OXAZOLIDINONE Chemical Properties |
| Melting point | 121-123 °C(lit.) | | Boiling point | 309.12°C (rough estimate) | | density | 1.1607 (rough estimate) | | refractive index | 1.5168 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | pka | 12.35±0.60(Predicted) | | form | solid | | color | Off-white | | Optical Rotation | [α]25/D 168°, c = 2 in chloroform | | InChI | InChI=1S/C10H11NO2/c1-7-9(13-10(12)11-7)8-5-3-2-4-6-8/h2-7,9H,1H3,(H,11,12)/t7-,9-/m0/s1 | | InChIKey | PPIBJOQGAJBQDF-CBAPKCEASA-N | | SMILES | O1[C@H](C2=CC=CC=C2)[C@H](C)NC1=O | | CAS DataBase Reference | 16251-45-9(CAS DataBase Reference) |
| Safety Statements | 24/25-25-24 | | WGK Germany | 3 | | HS Code | 29269090 | | Storage Class | 11 - Combustible Solids |
| | (4S,5R)-(-)-4-METHYL-5-PHENYL-2-OXAZOLIDINONE Usage And Synthesis |
| Chemical Properties | white crystals | | Uses | (4S,5R)-(-)-4-Methyl-5-phenyl-2-oxazolidinone may be used to synthesize (4S,5R)-N-tert-butyloxycarbonyl)-4-methyl-5-carboxy-2-oxazolidinone and (+)-pumiliotoxin B. |
| | (4S,5R)-(-)-4-METHYL-5-PHENYL-2-OXAZOLIDINONE Preparation Products And Raw materials |
|