- Methyl 4-nitrobenzoate
-
- $1.00 / 1KG
-
2019-07-06
- CAS:619-50-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: Customized
|
| | Methyl 4-nitrobenzoate Basic information |
| | Methyl 4-nitrobenzoate Chemical Properties |
| Melting point | 94-96 °C (lit.)
94-96 °C | | Boiling point | 314.24°C (rough estimate) | | density | 1.4283 (rough estimate) | | refractive index | 1.5468 (estimate) | | Fp | 94-96°C | | storage temp. | Sealed in dry,Room Temperature | | solubility | Solubility in methanol is almost transparent. | | form | powder to crystal | | color | Light orange to Yellow to Green | | BRN | 1912198 | | InChI | 1S/C8H7NO4/c1-13-8(10)6-2-4-7(5-3-6)9(11)12/h2-5H,1H3 | | InChIKey | YOJAHJGBFDPSDI-UHFFFAOYSA-N | | SMILES | COC(=O)c1ccc(cc1)[N+]([O-])=O | | CAS DataBase Reference | 619-50-1(CAS DataBase Reference) | | NIST Chemistry Reference | 4-Nitrobenzoic acid methyl ester(619-50-1) | | EPA Substance Registry System | Methyl-4-nitrobenzoate (619-50-1) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | RTECS | DH5775000 | | TSCA | TSCA listed | | HS Code | 29163900 | | Storage Class | 11 - Combustible Solids |
| | Methyl 4-nitrobenzoate Usage And Synthesis |
| Chemical Properties | light yellow to yellow fine crystalline powder | | Uses | It is employed in the biochemical characterization of NfsA, the Escherichia coli major nitroreductase exhibiting a high amino acid sequence homology to Frp, a Vibrio harveyi flavin oxidoreductase. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 60, p. 1466, 1995 DOI: 10.1021/jo00110a059 | | Purification Methods | Dissolve the benzoate in diethyl ether, then wash it with aqueous alkali; the ether is evaporated and the ester is recrystallised from EtOH. [Beilstein 9 H 390, 9 IV 1074.] |
| | Methyl 4-nitrobenzoate Preparation Products And Raw materials |
|