- Cbz-DL-Ser
-
-
2026-05-29
- CAS:2768-56-1
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
|
| | N-CARBOBENZOXY-DL-SERINE Basic information |
| | N-CARBOBENZOXY-DL-SERINE Chemical Properties |
| Melting point | 124-126 °C(lit.) | | Boiling point | 381.88°C (rough estimate) | | density | 1.2967 (rough estimate) | | refractive index | 1.4960 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | pka | 3.60±0.10(Predicted) | | color | White to Almost white | | BRN | 3593625 | | Major Application | peptide synthesis | | InChI | 1S/C11H13NO5/c13-6-9(10(14)15)12-11(16)17-7-8-4-2-1-3-5-8/h1-5,9,13H,6-7H2,(H,12,16)(H,14,15) | | InChIKey | GNIDSOFZAKMQAO-UHFFFAOYSA-N | | SMILES | OCC(NC(=O)OCc1ccccc1)C(O)=O | | CAS DataBase Reference | 2768-56-1(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids |
| | N-CARBOBENZOXY-DL-SERINE Usage And Synthesis |
| Chemical Properties | white powder | | Uses | Z-DL-Serine is a derivative of the primary amino acid serine. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | N-CARBOBENZOXY-DL-SERINE Preparation Products And Raw materials |
|