|
|
| | [4-(aminomethyl)cyclohexyl]methanamine Basic information |
| Product Name: | [4-(aminomethyl)cyclohexyl]methanamine | | Synonyms: | [4-(aminomethyl)cyclohexyl]methanamine;trans-1,4-Bis(aMinoMethyl)cyclohexane;trans-1,4-Cyclohexanedimethanamine;trans-1,4-Bis(aminomethyl)cyclohexane;trans-1,4-Di(aminomethyl)cyclohexane;trans-Hexahydro-p-xylylenediamine;((1R,4r)-cyclohexane-1,4-diyl)dimethanamine;1,4-Cyclohexanedimethanamine, trans- | | CAS: | 10029-07-9 | | MF: | C8H18N2 | | MW: | 142.24 | | EINECS: | | | Product Categories: | | | Mol File: | 10029-07-9.mol | ![[4-(aminomethyl)cyclohexyl]methanamine Structure](CAS/GIF/10029-07-9.gif) |
| | [4-(aminomethyl)cyclohexyl]methanamine Chemical Properties |
| Boiling point | 118°C/10mmHg(lit.) | | density | 0.912±0.06 g/cm3(Predicted) | | refractive index | 1.4870-1.4910 | | form | clear liquid | | pka | 10.57±0.29(Predicted) | | color | Colorless to Almost colorless | | InChI | InChI=1S/C8H18N2/c9-5-7-1-2-8(6-10)4-3-7/h7-8H,1-6,9-10H2/t7-,8- | | InChIKey | OXIKYYJDTWKERT-ZKCHVHJHSA-N | | SMILES | [C@@H]1(CN)CC[C@@H](CN)CC1 |
| RIDADR | 2922 | | HS Code | 2921.30.3000 | | HazardClass | 8/6.1 | | PackingGroup | II |
| | [4-(aminomethyl)cyclohexyl]methanamine Usage And Synthesis |
| | [4-(aminomethyl)cyclohexyl]methanamine Preparation Products And Raw materials |
|