| Company Name: |
Beijing Green Guardee Technology Co., Ltd |
| Tel: |
86-010-69706062 |
| Email: |
sales2@greenguardee.com |
| Products Intro: |
Product Name:[1,1',4',1",4",1"'-Quaterphenyl]-4,4'''-dicarbonaldehyde
CAS:110677-45-7
Purity:98% Package:1kg, 5kg, 20kg, at customer's requirement Remarks:oled materials
|
|
|
|
|
|
| | [1,1',4',1",4",1"'-Quaterphenyl]-4,4'''-dicarbonaldehyde Basic information |
| Product Name: | [1,1',4',1",4",1"'-Quaterphenyl]-4,4'''-dicarbonaldehyde | | Synonyms: | [1,1',4',1",4",1"'-Quaterphenyl]-4,4'''-dicarbonaldehyde;4-carbazol-9-ylbenzaldehyde;[1,1',4',1'',4'',1''',4''',1'''',4'''',1'''''-sexiphenyl]-4,4''';[1,4':1',1'':4'',1''':4''',1''''-Quinquephenyl]-4,4''''-dicarbon;N-(4-Formylphenyl)carbazole;4-(9H-carbazol-9-yl)benzaldehyde;Benzaldehyde, 4-(9H-carbazol-9-yl)-;9-(4-Formylphenyl)-9H-carbazole | | CAS: | 110677-45-7 | | MF: | C19H13NO | | MW: | 271.31 | | EINECS: | 200-258-5 | | Product Categories: | | | Mol File: | 110677-45-7.mol |  |
| | [1,1',4',1",4",1"'-Quaterphenyl]-4,4'''-dicarbonaldehyde Chemical Properties |
| Melting point | 153.0 to 158.0 °C | | Boiling point | 404.2±37.0 °C(Predicted) | | density | 1.16±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | form | powder to crystal | | color | White to Amber | | λmax | 355nm(Cyclohexane)(lit.) | | InChI | InChI=1S/C19H13NO/c21-13-14-9-11-15(12-10-14)20-18-7-3-1-5-16(18)17-6-2-4-8-19(17)20/h1-13H | | InChIKey | RPHLDCKUUAGNAC-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC=C(N2C3=C(C=CC=C3)C3=C2C=CC=C3)C=C1 |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 2933.99.7900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | [1,1',4',1",4",1"'-Quaterphenyl]-4,4'''-dicarbonaldehyde Usage And Synthesis |
| | [1,1',4',1",4",1"'-Quaterphenyl]-4,4'''-dicarbonaldehyde Preparation Products And Raw materials |
|