| Company Name: |
LGM Pharma |
| Tel: |
1-(800)-881-8210 |
| Email: |
inquiries@lgmpharma.com |
Nicoboxil manufacturers
- Nicoboxil
-
-
2026-08-07
- CAS:13912-80-6
- Min. Order: 1KG
- Purity: 98
- Nicoboxil
-
-
2026-06-30
- CAS:13912-80-6
- Min. Order: 1KG
- Purity: 98.0%
- Supply Ability: 10000KGS
|
| | Nicoboxil Basic information |
| Product Name: | Nicoboxil | | Synonyms: | NICOBOXIL;Butoxyethyl;3-Pyridinecarboxylic acid 2-butoxyethyl ester;Butoxyethyl nicotinate;Nicotinic acid 2-butoxyethyl ester;2-butoxyethyl nicotinate;beta-Butoxyethyl nicotinate;NICOBOXIL, BUTOXYETHYL NICOTINATE | | CAS: | 13912-80-6 | | MF: | C12H17NO3 | | MW: | 223.27 | | EINECS: | 237-684-7 | | Product Categories: | | | Mol File: | 13912-80-6.mol |  |
| | Nicoboxil Chemical Properties |
| Boiling point | 287.4±15.0 °C(Predicted) | | density | 1.066±0.06 g/cm3(Predicted) | | pka | 3.10±0.10(Predicted) | | Cosmetics Ingredients Functions | SKIN CONDITIONING | | InChI | InChI=1S/C12H17NO3/c1-2-3-7-15-8-9-16-12(14)11-5-4-6-13-10-11/h4-6,10H,2-3,7-9H2,1H3 | | InChIKey | IZJRISIINLJVBU-UHFFFAOYSA-N | | SMILES | C1=NC=CC=C1C(OCCOCCCC)=O | | LogP | 2.060 (est) |
| | Nicoboxil Usage And Synthesis |
| Uses | Nicoboxil is a medication used in the treatment of acute non-specific low back pains. | | Definition | ChEBI: Beta-Butoxyethyl nicotinate is an aromatic carboxylic acid and a member of pyridines. |
| | Nicoboxil Preparation Products And Raw materials |
|