|
|
| | ethyl (2Z)-2-methoxyimino-3-oxo-butanoate Basic information |
| Product Name: | ethyl (2Z)-2-methoxyimino-3-oxo-butanoate | | Synonyms: | ethyl (2Z)-2-methoxyimino-3-oxo-butanoate;2-Methoxyimino-3-oxobutyric acid ethyl ester;(Z)-ethyl 2-(methoxyimino)-3-oxobutanoate;Cefotaxime Impurity 2;ethyl 2-methoxyimino-3-oxobutanoate;2-(Methoxyimino)-3-oxo-butanoic Acid Ethyl Ester (E/Z-Mixture);Butanoic acid, 2-(methoxyimino)-3-oxo-, ethyl ester;2，3-Dioxobutyric acid 2-methyloxime ethyl ester | | CAS: | 60846-14-2 | | MF: | C7H11NO4 | | MW: | 173.17 | | EINECS: | | | Product Categories: | | | Mol File: | 60846-14-2.mol |  |
| | ethyl (2Z)-2-methoxyimino-3-oxo-butanoate Chemical Properties |
| Boiling point | 218.0±23.0 °C(Predicted) | | density | 1.11±0.1 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Chloroform, DMSO, Methanol | | form | Oil | | color | Light Orange to Orange | | InChI | InChI=1S/C7H11NO4/c1-4-12-7(10)6(5(2)9)8-11-3/h4H2,1-3H3 | | InChIKey | HASOOENYFDJEAK-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)C(=NOC)C(=O)C |
| | ethyl (2Z)-2-methoxyimino-3-oxo-butanoate Usage And Synthesis |
| Uses | 2-(Methoxyimino)-3-oxo-butanoic Acid Ethyl Ester (E/Z-Mixture) is the alternate form of (Z)-2-(Methoxyimino)-3-oxo-butanoic Acid Ethyl Ester (M313255), which is an intermediate in the synthesis of (E)-Cefodizime (C242880). (E)-Cefodizime can be obtained from Ethyl Acetate (E899545), a chemical intermediate used in the production of various analgesics, antibiotics and anti-malarial agents. |
| | ethyl (2Z)-2-methoxyimino-3-oxo-butanoate Preparation Products And Raw materials |
|