|
| 3,4,5-Trichlorobenzotrifluoride Basic information |
Product Name: | 3,4,5-Trichlorobenzotrifluoride | Synonyms: | 3,4,5-TRICHLORO-ALPHA,ALPHA,ALPHA-TRIFLUOROTOLUENE;3,4,5-TRICHLOROBENZOTRIFLUORIDE;1,2,3-TRICHLORO-5-(TRIFLUOROMETHYL)BENZENE;3,4,5-Trichlorobenzotrifluoride 98%;3,4,5-TRICHLOROTRIFLUORIDE;3,4,5-Trichlorobenzotrifluoride98%;Benzene, 1,2,3-trichloro-5-(trifluoromethyl)-;3,4,5-Trichloro-1-trifluoromethylbenzene | CAS: | 50594-82-6 | MF: | C7H2Cl3F3 | MW: | 249.45 | EINECS: | 256-636-6 | Product Categories: | alkyl chloride | Mol File: | 50594-82-6.mol |  |
| 3,4,5-Trichlorobenzotrifluoride Chemical Properties |
Melting point | -10--8 °C | Boiling point | 200-202 °C(lit.) | density | 1.6 g/mL at 25 °C(lit.) | refractive index | n20/D 1.5(lit.) | Fp | 209 °F | storage temp. | Sealed in dry,Room Temperature | form | clear liquid | Specific Gravity | 1.600 | color | Colorless to Almost colorless | BRN | 2212413 | InChI | InChI=1S/C7H2Cl3F3/c8-4-1-3(7(11,12)13)2-5(9)6(4)10/h1-2H | InChIKey | FBKFIAIRSQOXJR-UHFFFAOYSA-N | SMILES | C1(Cl)=CC(C(F)(F)F)=CC(Cl)=C1Cl | CAS DataBase Reference | 50594-82-6(CAS DataBase Reference) |
Hazard Codes | Xi | Risk Statements | 36/38 | Safety Statements | 24/25 | WGK Germany | 3 | Hazard Note | Irritant | HS Code | 29039990 |
| 3,4,5-Trichlorobenzotrifluoride Usage And Synthesis |
Chemical Properties | clear colorless liquid |
| 3,4,5-Trichlorobenzotrifluoride Preparation Products And Raw materials |
|