|
|
| | 3,4,5-Trichlorobenzotrifluoride Basic information |
| Product Name: | 3,4,5-Trichlorobenzotrifluoride | | Synonyms: | 3,4,5-TRICHLORO-ALPHA,ALPHA,ALPHA-TRIFLUOROTOLUENE;3,4,5-TRICHLOROBENZOTRIFLUORIDE;1,2,3-TRICHLORO-5-(TRIFLUOROMETHYL)BENZENE;3,4,5-Trichlorobenzotrifluoride 98%;3,4,5-TRICHLOROTRIFLUORIDE;3,4,5-Trichlorobenzotrifluoride98%;Benzene, 1,2,3-trichloro-5-(trifluoromethyl)-;3,4,5-Trichloro-1-trifluoromethylbenzene | | CAS: | 50594-82-6 | | MF: | C7H2Cl3F3 | | MW: | 249.45 | | EINECS: | 256-636-6 | | Product Categories: | alkyl chloride | | Mol File: | 50594-82-6.mol |  |
| | 3,4,5-Trichlorobenzotrifluoride Chemical Properties |
| Melting point | -10--8 °C | | Boiling point | 200-202 °C(lit.) | | density | 1.6 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.5(lit.) | | Fp | 209 °F | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | color | Colorless to Almost colorless | | Specific Gravity | 1.600 | | BRN | 2212413 | | InChI | InChI=1S/C7H2Cl3F3/c8-4-1-3(7(11,12)13)2-5(9)6(4)10/h1-2H | | InChIKey | FBKFIAIRSQOXJR-UHFFFAOYSA-N | | SMILES | C1(Cl)=CC(C(F)(F)F)=CC(Cl)=C1Cl | | CAS DataBase Reference | 50594-82-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/38 | | Safety Statements | 24/25 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29039990 |
| | 3,4,5-Trichlorobenzotrifluoride Usage And Synthesis |
| Chemical Properties | clear colorless liquid |
| | 3,4,5-Trichlorobenzotrifluoride Preparation Products And Raw materials |
|