| Company Name: |
Mainchem Co., Ltd.
|
| Tel: |
+86-0592-6210733 |
| Email: |
sale@mainchem.com |
| Products Intro: |
Product Name:3-HEPTAFLUOROBUTYRYL-(+)-CAMPHOR
CAS:51800-99-8
|
|
| | 3-HEPTAFLUOROBUTYRYL-(+)-CAMPHOR Basic information |
| Product Name: | 3-HEPTAFLUOROBUTYRYL-(+)-CAMPHOR | | Synonyms: | 3-(PERFLUOROBUTYRYL)-D-CAMPHOR;3-HEPTAFLUOROBUTYRYL-(+)-CAMPHOR;(+)-3-(HEPTAFLUOROBUTYRYL)-D-CAMPHOR;3-HEPTAFLUOROBUTYRYL-D-CAMPHOR;3-(Perfluorobutyryl)-(+)-caMphor 96%;(1R,4R)-2-(2,2,3,3,4,4,4-heptafluorobutanoyl)-4,7,7-trimethylbicyclo[2.2.1]heptan-3-one;(1R)-3-(2,2,3,3,4,4,4-heptafluoro-1-oxobutyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one;3-(2,2,3,3,4,4,4-Heptafluorobutanoyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one | | CAS: | 51800-99-8 | | MF: | C14H15F7O2 | | MW: | 348.26 | | EINECS: | 257-430-9 | | Product Categories: | Bicyclic Monoterpenes;Biochemistry;Terpenes | | Mol File: | 51800-99-8.mol |  |
| | 3-HEPTAFLUOROBUTYRYL-(+)-CAMPHOR Chemical Properties |
| Boiling point | 60-70 °C0.2 mm Hg(lit.) | | density | 1.218 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.421(lit.) | | Fp | 201 °F | | pka | 7.94±0.60(Predicted) | | color | light yellow | | Optical Rotation | [α]20/D +125°, c = 2.6 in chloroform | | BRN | 2306496 | | InChI | 1S/C14H15F7O2/c1-10(2)6-4-5-11(10,3)8(22)7(6)9(23)12(15,16)13(17,18)14(19,20)21/h6-7H,4-5H2,1-3H3/t6-,7,11+/m1/s1 | | InChIKey | PEWOESYEGLBLNR-XGLFCGLISA-N | | SMILES | CC1(C)C2CC[C@@]1(C)C(=O)C2C(=O)C(F)(F)C(F)(F)C(F)(F)F | | CAS DataBase Reference | 51800-99-8(CAS DataBase Reference) | | EPA Substance Registry System | (1R,4R)-3-(Heptafluorobutyryl)-camphor (51800-99-8) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 3-HEPTAFLUOROBUTYRYL-(+)-CAMPHOR Usage And Synthesis |
| Uses | 3-(Perfluorobutyryl)-(+)-camphor can be used:
- As a ligand in the synthesis of chiral europium complex for optoelectronic and photonic applications.
- As a ligand in the preparation of sodium tetrakis(3-heptafluorobutylryl-(+)-camphorato) Ln(III) complexes applicable as chemical sensors and NMR shift reagents.
|
| | 3-HEPTAFLUOROBUTYRYL-(+)-CAMPHOR Preparation Products And Raw materials |
|