|
|
| | Stearolic acid Basic information |
| Product Name: | Stearolic acid | | Synonyms: | 9-octadecynoic acid;STEAROLIC ACID;OCTADEC-9-YNOIC ACID;Stearolicacid,98%;9-stearolic acid;9-hydroxy-3-methyl-1H-benzo[g]quinoline-2,5,10-trione | | CAS: | 506-24-1 | | MF: | C18H32O2 | | MW: | 280.45 | | EINECS: | 208-030-8 | | Product Categories: | | | Mol File: | 506-24-1.mol |  |
| | Stearolic acid Chemical Properties |
| Melting point | 46-47°C | | Boiling point | 189-190°C 2mm | | density | 0.9365 (rough estimate) | | refractive index | 1.4283 (estimate) | | Fp | 189-190°C/2mm | | storage temp. | -20°C | | pka | 4.77±0.10(Predicted) | | form | Solid | | color | White to off-white | | Water Solubility | Insoluble in water. | | BRN | 1786634 | | InChI | InChI=1S/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-8,11-17H2,1H3,(H,19,20) | | InChIKey | RGTIBVZDHOMOKC-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCCCCCCC#CCCCCCCCC | | NIST Chemistry Reference | 9-Octadecynoic acid(506-24-1) |
| Provider | Language |
|
ALFA
| English |
| | Stearolic acid Usage And Synthesis |
| Uses | 9-Octadecynoic Acid, is used as an important organic intermediate. It can be used in agrochemical, pharmaceutical and dyestuff field. | | Definition | ChEBI: An octadecynoic acid having its triple bond at position 9. |
| | Stearolic acid Preparation Products And Raw materials |
|