- METHYL ORSELLINATE
-
- $0.00 / 1KG
-
2025-03-21
- CAS:3187-58-4
- Min. Order: 0.1KG
- Purity: 98%
- Supply Ability: 1000KGS
- Methyl orsellinate
-
- $1.00 / 1Kg
-
2024-07-09
- CAS:3187-58-4
- Min. Order: 1Kg
- Purity: 98%
- Supply Ability: 20T
|
| | methyl orsellinate Basic information |
| Product Name: | methyl orsellinate | | Synonyms: | Orsellinic acid methyl;6-Methyl-β-resorcylic acid methyl;Methyl o-orsellinate;o-Orsellinic acid methyl;BENZOIC ACID,2,4-DIHYDROXY-6-METHYL-, METHYL ESTER;6-Methyl-β-resorcylicacidmethyl;METHYL ORSELLINATE;Methyl | | CAS: | 3187-58-4 | | MF: | C9H10O4 | | MW: | 182.17 | | EINECS: | | | Product Categories: | Aromatic Esters | | Mol File: | 3187-58-4.mol |  |
| | methyl orsellinate Chemical Properties |
| Melting point | 141-142℃ | | Boiling point | 339℃ | | density | 1.296 | | Fp | 138℃ | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 8.27±0.23(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C9H10O4/c1-5-3-6(10)4-7(11)8(5)9(12)13-2/h3-4,10-11H,1-2H3 | | InChIKey | NCCWCZLEACWJIN-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=C(C)C=C(O)C=C1O | | LogP | 2.380 (est) | | EPA Substance Registry System | Benzoic acid, 2,4-dihydroxy-6-methyl-, methyl ester (3187-58-4) |
| RIDADR | UN 2398 (METHYL tert-BUTYL ETHER) | | TSCA | TSCA listed | | HazardClass | 3 | | PackingGroup | II | | HS Code | 2918290090 |
| | methyl orsellinate Usage And Synthesis |
| Uses | Methyl 2,4-Dihydroxy-6-methylbenzoate (methyl orsellinate) is a useful synthetic intermediate in the synthesis of Grifolic Acid (G786500); a selective partial GPR120 agonist. Grifolic Acid induces ERK and [Ca2+]i responses in cells expressing GPR120, but has no effects on those expressing GPR40. | | Definition | ChEBI: Orsellinic acid methyl ester is a hydroxybenzoic acid. It has a role as a metabolite. | | Biochem/physiol Actions | Methyl orsellinate, an antifungal compound, is produced during submerged culture from Sparassis crispa. Methyl orsellinate have appeared to have higher antifungal activity than sparassol. Methyl orsellinate is a phytotoxic compound; it can cause significant inhibition of radicle growth of Amaranthus hypochondriacus and Echinochloa crus-galli, interact with bovine-brain calmodulin and inhibit the activation of the calmodulin-dependent enzyme cAMP phosphodiesterase. It could inhibit PTP1B activity with 50% inhibitory concentration values of 277 +/- 8.6 microM; the selective inhibition of PTP1B has been widely recognized as a potential drug target for the treatment of type 2 diabetes and obesity; methyl orsellinate may treat the type 2 diabetes and obesity. |
| | methyl orsellinate Preparation Products And Raw materials |
|