|
|
| | 3,5,4''-TRIHYDROXY-7-METHOXYFLAVONE Basic information |
| Product Name: | 3,5,4''-TRIHYDROXY-7-METHOXYFLAVONE | | Synonyms: | 4H-1-Benzopyran-4-one, 3,5-dihydroxy-2-(4-hydroxyphenyl)-7-methoxy-;7-Methylkaempferol;Kaempferol 7-methyl ether;Indoctrination;astragalus,flavonoid,inhibit,anti-inflammatory,Rhamnocitrin,Inhibitor,complanatus,an-tiatherosclerosis,anti-oxidant,DPPH;3,5,4''-TRIHYDROXY-7-METHOXYFLAVONE;3,4',5-Trihydroxy 7-methoxyflavone;Rhamnocitrin-RM | | CAS: | 569-92-6 | | MF: | C16H12O6 | | MW: | 300.26 | | EINECS: | | | Product Categories: | Flavanols | | Mol File: | 569-92-6.mol |  |
| | 3,5,4''-TRIHYDROXY-7-METHOXYFLAVONE Chemical Properties |
| Melting point | 225-227℃ | | Boiling point | 571.9±50.0 °C(Predicted) | | density | 1.538 | | storage temp. | 2-8°C | | solubility | Soluble in methan | | form | powder | | pka | 6.18±0.40(Predicted) | | color | Yellow | | Major Application | food and beverages | | InChI | InChI=1S/C16H12O6/c1-21-10-6-11(18)13-12(7-10)22-16(15(20)14(13)19)8-2-4-9(17)5-3-8/h2-7,17-18,20H,1H3 | | InChIKey | MQSZRBPYXNEFHF-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(O)C=C2)OC2=CC(OC)=CC(O)=C2C(=O)C=1O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 3,5,4''-TRIHYDROXY-7-METHOXYFLAVONE Usage And Synthesis |
| Uses | food and beverages | | Definition | ChEBI: A monomethoxyflavone that is the 7-methyl ether derivative of kaempferol. | | in vivo | After oral administration of A. complanatus extract (10 mL/kg) to rats (equivalent to 17.6 mg/kg Rhamnocitrin), blood (approximately 0.3 mL) is collected from the ocular vein for analysis at 0, 0.083, 0.167, 0.25, 0.333, 0.5, 0.75, 1, 2, 4, 6, 9, and 12 hours after administration under ether anesthesia. The results shows that the plasma concentration of Rhamnocitrin reached its maximum at 0.65 hours, with an average Cmax of 29.57 ng/mL[1]. | | target | HO-1 | ERK | MEK | p38MAPK | Immunology & Inflammation related |
| | 3,5,4''-TRIHYDROXY-7-METHOXYFLAVONE Preparation Products And Raw materials |
|