- MARRUBIIN
-
- $1.00 / 1KG
-
2019-07-06
- CAS:465-92-9
- Min. Order: 1g
- Purity: 99%
- Supply Ability: 100KG
|
| | MARRUBIIN Basic information |
| Product Name: | MARRUBIIN | | Synonyms: | MARRUBIIN;5-[2-(3-furyl)ethyl]decahydro-5-hydroxy-1,4a,6-trimethyl-1,8-naphthalenecarbolactone;MARRUBIIN(P);6β-[2-(3-Furanyl)ethyl]decahydro-6α-hydroxy-2aα,5aβ,7α-trimethyl-2H-naphtho[1,8-bc]furan-2-one;MARRUBIIN(SH);MarrubiuM bitter;Marrubin;Marrubiin CRS | | CAS: | 465-92-9 | | MF: | C20H28O4 | | MW: | 332.43 | | EINECS: | | | Product Categories: | Di-Terpenoids | | Mol File: | 465-92-9.mol |  |
| | MARRUBIIN Chemical Properties |
| Melting point | 159-162°C | | alpha | D20 +35.8° (c = 3.1 in chloroform); D24 +45° (acetone) | | Boiling point | 297-299 °C(Press: 15 Torr) | | density | 1.152±0.06 g/cm3 (20 ºC 760 Torr) | | storage temp. | 4°C, protect from light | | solubility | DMSO: 100 mg/mL (300.82 mM) | | pka | 14.66±0.70(Predicted) | | form | A solid | | color | White to off-white | | biological source | plant | | Optical Rotation | +35.820 (c 3.1, CHCl3) | | Major Application | metabolomics
vitamins, nutraceuticals, and natural products | | InChI | 1S/C20H28O4/c1-13-11-15-16-18(2,17(21)24-15)7-4-8-19(16,3)20(13,22)9-5-14-6-10-23-12-14/h6,10,12-13,15-16,22H,4-5,7-9,11H2,1-3H3/t13-,15-,16+,18+,19+,20-/m1/s1 | | InChIKey | HQLLRHCTVDVUJB-OBHOOXMTSA-N | | SMILES | [o]1cc(cc1)CC[C@@]2([C@@]3([C@H]4[C@H](OC(=O)[C@]4(CCC3)C)C[C@H]2C)C)O | | LogP | 3.400 (est) |
| Risk Statements | 25 | | Safety Statements | 1-22-45 | | RIDADR | 2811 | | WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | MARRUBIIN Usage And Synthesis |
| Uses | Marrubiin is an α-glucosidase inhibitor and an analgesic compound. | | Definition | ChEBI: Marrubiin is a gamma-lactone. | | Biological Activity | Based on existing research, Marrubiin has demonstrated the ability to inhibit the production of pro-inflammatory cytokines and reduce the activity of enzymes involved in oxidative stress. Additionally, it has been observed to lower blood pressure and provide protection against ischemic heart injury. |
| | MARRUBIIN Preparation Products And Raw materials |
|