| Company Name: |
Suzhou Rovathin Foreign Trade Co.,Ltd
|
| Tel: |
0512-65816829 18662214788 |
| Email: |
info@rovathin.com.cn |
| Products Intro: |
Product Name:4-(nitrooxy)butyl bromide
CAS:146563-40-8
Purity:95% Package:1g;10g;100g; 1kg
|
| Company Name: |
Ningbo jinuo chemical co., LTD
|
| Tel: |
0574-87314919 057487319282 |
| Email: |
info@nbinno.com |
| Products Intro: |
Product Name:4-bromobutyl nitrate
CAS:146563-40-8
Purity:99.0%
|
4-bromobutyl nitrate manufacturers
|
| | 4-bromobutyl nitrate Basic information |
| Product Name: | 4-bromobutyl nitrate | | Synonyms: | 4-bromobutyl nitrate;4-(nitrooxy)butyl bromide;4-Bromo-1-butanol 1-Nitrate;1-Butanol, 4-bromo-, 1-nitrate;SKL119 | | CAS: | 146563-40-8 | | MF: | C4H8BrNO3 | | MW: | 198.02 | | EINECS: | | | Product Categories: | | | Mol File: | 146563-40-8.mol |  |
| | 4-bromobutyl nitrate Chemical Properties |
| Boiling point | 220.0±23.0 °C(Predicted) | | density | 1.560±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator, under inert atmosphere | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | color | Pale Yellow | | InChI | InChI=1S/C4H8BrNO3/c5-3-1-2-4-9-6(7)8/h1-4H2 | | InChIKey | IKDHVMDABUMCLO-UHFFFAOYSA-N | | SMILES | C(O[N+]([O-])=O)CCCBr |
| | 4-bromobutyl nitrate Usage And Synthesis |
| Uses | 4-bromobutyl nitrate is an intermediate in synthesizing Latanoprostene Bunod (L177335). It is a derivative of Latanoprost and is used in the treatment of interocular pressure. | | Preparation | 4-Bromobutyl nitrate is a thermally unstable oily liquid, which is used to obtain nitrooxyalkyl esters of pharmacologically active carboxylic acids (WO 04/020384, WO 04/020385). 4-Bromobutyl nitrate not dissolved in solvents is added to the solution / suspension of pharmacologically active carboxylic acids such as naproxen, ferulic acid, etc. 4-Bromobutyl nitrate is obtained by nitration with a sulfonitizing mixture of 4-bromo-1-hydroxybutane (Chem. Pharm. Bull., 1993, 41, p. 1040). The reaction is carried out by adding 4-bromo-1-hydroxybutane to the crude sulphonating mixture in the absence of solvents or diluents. The reaction is limited to a laboratory scale since the method is potentially explosive due to a sudden increase in temperature and gas production.
https://patents.google.com/patent/RU2388746C2/en |
| | 4-bromobutyl nitrate Preparation Products And Raw materials |
|