|
|
| | 7-METHOXY-1-METHYL-2-TETRALONE Basic information |
| Product Name: | 7-METHOXY-1-METHYL-2-TETRALONE | | Synonyms: | 7-METHOXY-1-METHYL-2-TETRALONE;7-methoxy-1-methyl-3,4-dihydronaphthalen-2(1H)-one;3,4-dihydro-7-methoxy-1-methyl-2(1H)-naphthalenone;1-methyl-7-methoxy-2-tetralinone;2(1H)-Naphthalenone, 3,4-dihydro-7-methoxy-1-methyl-;7-methoxy-1-methyl-tetralin-2-one;1-methyl-7-methoxy-2-naphthaleneone | | CAS: | 1204-23-5 | | MF: | C12H14O2 | | MW: | 190.24 | | EINECS: | | | Product Categories: | | | Mol File: | 1204-23-5.mol |  |
| | 7-METHOXY-1-METHYL-2-TETRALONE Chemical Properties |
| Boiling point | 125-126 °C(Press: 0.8 Torr) | | density | 1.076±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | Appearance | White to off-white Solid | | InChI | InChI=1S/C12H14O2/c1-8-11-7-10(14-2)5-3-9(11)4-6-12(8)13/h3,5,7-8H,4,6H2,1-2H3 | | InChIKey | DYIWPPSNJSVFED-UHFFFAOYSA-N | | SMILES | C1(C)C2=C(C=CC(OC)=C2)CCC1=O |
| | 7-METHOXY-1-METHYL-2-TETRALONE Usage And Synthesis |
| Uses | 7-Methoxy-1-methyl-2-tetralone is a reagent that is used in the synthesis of dezocine (D299800), which is an opioid analgesic that is related to Pentazocine (P274300). |
| | 7-METHOXY-1-METHYL-2-TETRALONE Preparation Products And Raw materials |
|