|
|
| | tert-Butyl N-((2S,1S)-2-hydroxycyclohexyl)carbamate Basic information |
| Product Name: | tert-Butyl N-((2S,1S)-2-hydroxycyclohexyl)carbamate | | Synonyms: | tert-Butyl N-((2S,1S)-2-hydroxycyclohexyl)carbamate;Carbamic acid, [(1S,2S)-2-hydroxycyclohexyl]-, 1,1-dimethylethyl ester (9CI);(1S,2S)-trans-N-Boc-2-Aminocyclohexanol;tert-butyl (1S,2S)-2-hydroxycyclohexylcarbamate;2S)-2-hydroxycyclohexyl]-;1S,S-Boc-2-aMinocyclohexanol;CarbaMic acid, N-[(1S,2S)-2-hydroxycyclohexyl]-, 1,1-diMethylethyl ester;tert-butyl N-[(1S,2S)-2-hydroxycyclohexyl]carbamate | | CAS: | 145166-06-9 | | MF: | C11H21NO3 | | MW: | 215.29 | | EINECS: | | | Product Categories: | Amino Alcohols;Chiral Building Blocks;Organic Building Blocks;API intermediates | | Mol File: | 145166-06-9.mol |  |
| | tert-Butyl N-((2S,1S)-2-hydroxycyclohexyl)carbamate Chemical Properties |
| Boiling point | 337.7±31.0 °C(Predicted) | | density | 1.06±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | pka | 12.11±0.40(Predicted) | | form | solid | | Appearance | White to off-white Solid | | BRN | 5810950 | | InChI | InChI=1S/C11H21NO3/c1-11(2,3)15-10(14)12-8-6-4-5-7-9(8)13/h8-9,13H,4-7H2,1-3H3,(H,12,14)/t8-,9-/m0/s1 | | InChIKey | XVROWZPERFUOCE-IUCAKERBSA-N | | SMILES | C(OC(C)(C)C)(=O)N[C@H]1CCCC[C@@H]1O |
| Hazard Codes | Xn,N | | Risk Statements | 22-50 | | Safety Statements | 61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 3 |
| | tert-Butyl N-((2S,1S)-2-hydroxycyclohexyl)carbamate Usage And Synthesis |
| Synthesis | General procedure for the synthesis of trans-N-Boc-cyclohexylamino alcohols from the compounds (CAS: 764659-69-0): the product of part A (8.0 g, 26.2 mmol) was dissolved in a solvent mixture of cyclohexene (100 mL) and ethanol (150 mL), and palladium/carbon catalyst (2.0 g) was added. The reaction mixture was heated to reflux for 6 h. Upon completion of the reaction, the catalyst was removed by filtration through a Celite pad. The filtrate was concentrated to afford tert-butyl (1S,2S)-2-hydroxy-cyclohexyl-carbamate (5.7 g, 100% yield) as a white solid. Mass spectral analysis showed M/Z 216.2 ([M + H]+). | | References | [1] Patent: WO2004/83174, 2004, A2. Location in patent: Page 172
[2] Patent: WO2005/87731, 2005, A1. Location in patent: Page/Page column 321
[3] Bioorganic and Medicinal Chemistry Letters, 2007, vol. 17, # 16, p. 4419 - 4427
[4] Bioorganic and Medicinal Chemistry, 2009, vol. 17, # 1, p. 119 - 132 |
| | tert-Butyl N-((2S,1S)-2-hydroxycyclohexyl)carbamate Preparation Products And Raw materials |
|