|
|
| | METHYL 2-HYDROXY-3-NITROBENZOATE Basic information |
| | METHYL 2-HYDROXY-3-NITROBENZOATE Chemical Properties |
| Melting point | 127-132 °C | | Boiling point | 263.9±20.0 °C(Predicted) | | density | 1.432±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Crystalline Powder | | pka | 6.85±0.24(Predicted) | | color | Yellow | | InChI | InChI=1S/C8H7NO5/c1-14-8(11)5-3-2-4-6(7(5)10)9(12)13/h2-4,10H,1H3 | | InChIKey | NIBVYEHAFBEVFI-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC=CC([N+]([O-])=O)=C1O |
| | METHYL 2-HYDROXY-3-NITROBENZOATE Usage And Synthesis |
| Chemical Properties | yellow crystalline powder | | Uses | 3-Nitrosalicylic Acid Methyl Ester is an derivative of 3-Nitrosalicylic acid (N520905), which has been shown to bind to Molybdenum to impart fertility to soil and water and is a key element in the activity of nitrogenase. | | Synthesis | The conventional method for the synthesis of methyl 3-nitrosalicylate generally involves direct nitration of methyl salicylate with a mixture of nitric and sulfuric acids, but the regioselectivity is dominated by 5-position nitration, with a yield of about 10% of methyl 3-nitrosalicylate. |
| | METHYL 2-HYDROXY-3-NITROBENZOATE Preparation Products And Raw materials |
|