| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:ZH8659 hydrochloride
|
| Company Name: |
SIGMA ALDRICH IRELAND LTD
|
| Tel: |
800 558-9160 |
| Email: |
marsha_walker@sigmaaldrich.com |
| Products Intro: |
Product Name:ZH8659 hydrochloride
|
|
| | ZH8659 hydrochloride Basic information |
| | ZH8659 hydrochloride Chemical Properties |
| storage temp. | 2-8°C | | solubility | DMSO: 2mg/mL, clear | | form | powder | | color | white to beige | | InChI | 1S/C12H13NO.ClH/c13-8-7-10-3-5-11(6-4-10)12-2-1-9-14-12;/h1-6,9H,7-8,13H2;1H | | InChIKey | PIDHDDFXZYDGMH-UHFFFAOYSA-N | | SMILES | NCCC1=CC=C(C2=CC=CO2)C=C1.Cl |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | ZH8659 hydrochloride Usage And Synthesis |
| Biological Activity | Orally available, potent and selective agonist of Trace amine-associated receptor 1 (TAAR1); potent Gq-selective agonist of mTAAR1/hTAAR1.
ZH8659 is an orally available, potent and selective agonist of Trace amine-associated receptor 1 (TAAR1). ZH8659 is a potent Gq-selective agonist of mTAAR1/hTAAR1 (EC50 = 2.6 nM (Gq)). ZH8659 alleviates MK-801-induced schizophrenia-like phenotypes without inducing catalepsy in mice. |
| | ZH8659 hydrochloride Preparation Products And Raw materials |
|