| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Company Name: |
ART-CHEM GmbH |
| Tel: |
+7 495 135 4 135 |
| Email: |
art-chem@art-chem.com |
|
| | 2,6-Dibromo-4-(6-methyl-1,3-benzothiazol-2-yl)aniline Basic information |
| Product Name: | 2,6-Dibromo-4-(6-methyl-1,3-benzothiazol-2-yl)aniline | | Synonyms: | 2,6-DIBROMO-4-(6-METHYL-1,3-BENZOTHIAZOL-2-YL)PHENYLAMINE;AKOS BB-7999;ART-CHEM-BB B025082;ASISCHEM B52422;TIMTEC-BB SBB001437;2,6-Dibromo-4-(6-methylbenzo[d]thiazol-2-yl)aniline;2,6-Dibromo-4-(6-methyl-1,3-benzothiazol-2-yl)aniline | | CAS: | | | MF: | C14H10Br2N2S | | MW: | 398.12 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 2,6-Dibromo-4-(6-methyl-1,3-benzothiazol-2-yl)aniline Chemical Properties |
| form | solid | | InChI | 1S/C14H10Br2N2S/c1-7-2-3-11-12(4-7)19-14(18-11)8-5-9(15)13(17)10(16)6-8/h2-6H,17H2,1H3 | | InChIKey | QIDGKIRSXPYFSO-UHFFFAOYSA-N | | SMILES | CC1=CC=C2N=C(C3=CC(Br)=C(N)C(Br)=C3)SC2=C1 |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 2,6-Dibromo-4-(6-methyl-1,3-benzothiazol-2-yl)aniline Usage And Synthesis |
| | 2,6-Dibromo-4-(6-methyl-1,3-benzothiazol-2-yl)aniline Preparation Products And Raw materials |
|