- 1-Methyl-3-phenylpiperazine
-
- $15.00 / 1KG
-
2021-07-02
- CAS:5271-27-2
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | 1-Methyl-3-phenylpiperazine Basic information |
| | 1-Methyl-3-phenylpiperazine Chemical Properties |
| Melting point | 56-60 °C (lit.) | | Boiling point | 85 °C | | density | 0.991±0.06 g/cm3(Predicted) | | Fp | 85°C/0.5mm | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 8.52±0.40(Predicted) | | form | Needles or Crystals | | color | Pale yellow | | Water Solubility | soluble | | Sensitive | Air Sensitive | | InChI | InChI=1S/C11H16N2/c1-13-8-7-12-11(9-13)10-5-3-2-4-6-10/h2-6,11-12H,7-9H2,1H3 | | InChIKey | IRMBVBDXXYXPEW-UHFFFAOYSA-N | | SMILES | N1(C)CCNC(C2=CC=CC=C2)C1 | | CAS DataBase Reference | 5271-27-2(CAS DataBase Reference) |
| Hazard Codes | T,Xi | | Risk Statements | 25-34-36/37/38 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 2923 8/PG 3 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29335990 |
| | 1-Methyl-3-phenylpiperazine Usage And Synthesis |
| Chemical Properties | 1-Methyl-3-phenylpiperazine is Off-White Solid | | Uses | Piperazine derivative used as reference materials for forensic laboratories. They affect the central and the autonomic nervous systems, the blood pressure, and smooth muscle. | | Uses | 1-Methyl-3-phenylpiperazine used as reference materials for forensic laboratories. They affect the central and the autonomic nervous systems, the blood pressure, and smooth muscle. |
| | 1-Methyl-3-phenylpiperazine Preparation Products And Raw materials |
|