|
|
| | N-(4-(2-aminoacetyl)-5-methoxy-2-phenoxyphenyl)methanesulfonamide hydrochloride Basic information |
| Product Name: | N-(4-(2-aminoacetyl)-5-methoxy-2-phenoxyphenyl)methanesulfonamide hydrochloride | | Synonyms: | N-(4-(2-aminoacetyl)-5-methoxy-2-phenoxyphenyl)methanesulfonamide hydrochloride;2-Amino-1-(2-methoxy-4-methanesulfonylamino-5-phenoxyphenyl)ethanone hydrochloride;Methanesulfonamide,N-[4-(2-aminoacetyl)-5-methoxy-2-phenoxyphenyl]-,hydrochloride;-5-methoxy-2-phenoxyphenyl);N-(4-(2-Aminoacetyl);Iguratimod Impurity 8;N-[4-(2-amino-1-oxoethyl)-5-methoxy-2-phenoxyphenyl]methanesulfonamide hydrochloride;Cas No | | CAS: | 149436-41-9 | | MF: | C16H19ClN2O5S | | MW: | 386.85 | | EINECS: | | | Product Categories: | | | Mol File: | 149436-41-9.mol |  |
| | N-(4-(2-aminoacetyl)-5-methoxy-2-phenoxyphenyl)methanesulfonamide hydrochloride Chemical Properties |
| storage temp. | Inert atmosphere,Room Temperature | | Appearance | White to off-white Solid | | InChI | InChI=1S/C16H18N2O5S.ClH/c1-22-15-9-13(18-24(2,20)21)16(8-12(15)14(19)10-17)23-11-6-4-3-5-7-11;/h3-9,18H,10,17H2,1-2H3;1H | | InChIKey | NWUBXODWWYGUHS-UHFFFAOYSA-N | | SMILES | O(C1C=CC=CC=1)C1C=C(C(=O)CN)C(OC)=CC=1NS(=O)(=O)C.Cl |
| | N-(4-(2-aminoacetyl)-5-methoxy-2-phenoxyphenyl)methanesulfonamide hydrochloride Usage And Synthesis |
| Chemical Properties | 2-Amino-1-(2-methoxy-4-methanesulfonamido-5-phenoxyphenyl)ethanone hydrochloride is a hydrochloride salt of an organic amine, the preparation of which into the corresponding hydrochloride salt facilitates its ease of transportation, and the formation of the hydrochloride salt improves the solubility of the compound in water and enhances its chemical stability. | | Uses | N-(4-(2-aminoacetyl)-5-methoxy-2-phenoxyphenyl)methanesulfonamide hydrochloride is a pharmaceutical intermediate compound mainly used in the field of organic synthesis. It can be used as iguratimod intermediate. |
| | N-(4-(2-aminoacetyl)-5-methoxy-2-phenoxyphenyl)methanesulfonamide hydrochloride Preparation Products And Raw materials |
|