| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 1,4-Bis(octyloxy)-2,5-xylenebis(triphenylphosphonium bromide) Basic information |
| | 1,4-Bis(octyloxy)-2,5-xylenebis(triphenylphosphonium bromide) Chemical Properties |
| Melting point | 230.8-235.1 °C (lit.) | | InChIKey | OIUNYEDNNJLODO-UHFFFAOYSA-L | | SMILES | [Br-].[Br-].CCCCCCCCOc1cc(C[P+](c2ccccc2)(c3ccccc3)c4ccccc4)c(OCCCCCCCC)c(C[P+](c5ccccc5)(c6ccccc6)c7ccccc7)c1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1,4-Bis(octyloxy)-2,5-xylenebis(triphenylphosphonium bromide) Usage And Synthesis |
| | 1,4-Bis(octyloxy)-2,5-xylenebis(triphenylphosphonium bromide) Preparation Products And Raw materials |
|