|
|
| | 2-Naphthalenesulfonyl chloride Basic information |
| | 2-Naphthalenesulfonyl chloride Chemical Properties |
| Melting point | 74-76 °C (lit.) | | Boiling point | 147.7 °C/0.6 mmHg (lit.) | | density | 1.3661 (estimate) | | vapor pressure | 0.004Pa at 25℃ | | Fp | 200-202°C/13mm | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | soluble in Toluene | | form | Powder | | color | Light yellow to beige | | Water Solubility | insoluble | | Sensitive | Moisture Sensitive | | BRN | 641898 | | InChI | 1S/C10H7ClO2S/c11-14(12,13)10-6-5-8-3-1-2-4-9(8)7-10/h1-7H | | InChIKey | OPECTNGATDYLSS-UHFFFAOYSA-N | | SMILES | ClS(=O)(=O)c1ccc2ccccc2c1 | | LogP | 2.2 at 25℃ | | CAS DataBase Reference | 93-11-8(CAS DataBase Reference) | | NIST Chemistry Reference | 2-Naphthalenesulfonyl chloride(93-11-8) | | EPA Substance Registry System | 2-Naphthalenesulfonyl chloride (93-11-8) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45-27 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | F | 21 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29049020 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1 Met. Corr. 1 Skin Corr. 1B |
| | 2-Naphthalenesulfonyl chloride Usage And Synthesis |
| Chemical Properties | LIGHT YELLOW TO BEIGE POWDER | | Uses | 2-Naphthalenesulfonyl chloride was employed as capping reagent for primary amine to convert histamine to a selective histamine H3-receptor antagonist. It was used for pre-column derivatization during the high-performance liquid chromatographic assay of neomycin sulfate. | | Flammability and Explosibility | Not classified | | Purification Methods | Distil the chloride in a vacuum and/or recrystallise it (twice) from *benzene/pet ether (1:1 v/v). Purify it as the 1-sulfonyl chloride above. [Fierz-Davaid & Weissenbach Helv Chim Acta 3 2312 1920.] The sulfonamide has m 217o (from EtOH). [Beilstein 11 III 399, 11 IV 529.] |
| | 2-Naphthalenesulfonyl chloride Preparation Products And Raw materials |
|