|
|
| | 4-Chloro-2-fluoro-5-sulfamylbenzoic acid Basic information |
| Product Name: | 4-Chloro-2-fluoro-5-sulfamylbenzoic acid | | Synonyms: | 4-CHLORO-2-FLUORO-5-SULFAMOYLBENZOIC ACID;4-CHLORO-2-FLUORO-5-SULFAMYLBENZOIC ACID;2-FLUORO-4-CHLORO-5-SULFAMOYL BENZOIC ACID;5-(Aminosulfonyl)-4-chloro-2-fluorobenzoic acid;4-Chloro-2-fluoro-5-;Benzoic acid,5-(aMinosulfonyl)-4-chloro-2-fluoro-;4-Chloro-2-fluoro-5-aminosulfonylbenzoic acid | | CAS: | 4793-22-0 | | MF: | C7H5ClFNO4S | | MW: | 253.64 | | EINECS: | | | Product Categories: | API intermediates | | Mol File: | 4793-22-0.mol |  |
| | 4-Chloro-2-fluoro-5-sulfamylbenzoic acid Chemical Properties |
| Melting point | 242-245 °C | | Boiling point | 474.8±55.0 °C(Predicted) | | density | 1.724±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 2.51±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C7H5ClFNO4S/c8-4-2-5(9)3(7(11)12)1-6(4)15(10,13)14/h1-2H,(H,11,12)(H2,10,13,14) | | InChIKey | FDPTZONHYRXKLK-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(S(N)(=O)=O)=C(Cl)C=C1F | | CAS DataBase Reference | 4793-22-0(CAS DataBase Reference) |
| | 4-Chloro-2-fluoro-5-sulfamylbenzoic acid Usage And Synthesis |
| | 4-Chloro-2-fluoro-5-sulfamylbenzoic acid Preparation Products And Raw materials |
|