- Phenylacetyl disulfide
-
- $1.00 / 1kg
-
2026-01-30
- CAS:15088-78-5
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 10 mt
- Phenylacetyl disulfide
-
- $3.00 / 1KG
-
2020-01-08
- CAS:15088-78-5
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 200KG
|
| | Phenylacetyl disulfide Basic information |
| | Phenylacetyl disulfide Chemical Properties |
| Melting point | 59-63 °C (lit.) | | Boiling point | 481.1±48.0 °C(Predicted) | | density | 1.269±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | powder to crystal | | color | White to Almost white | | Water Solubility | Insoluble in water. | | BRN | 2057579 | | InChI | InChI=1S/C16H14O2S2/c17-15(11-13-7-3-1-4-8-13)19-20-16(18)12-14-9-5-2-6-10-14/h1-10H,11-12H2 | | InChIKey | IXGZXXBJSZISOO-UHFFFAOYSA-N | | SMILES | S(C(CC1=CC=CC=C1)=O)SC(CC1=CC=CC=C1)=O | | CAS DataBase Reference | 15088-78-5(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 2 | | HS Code | 29309090 | | Storage Class | 11 - Combustible Solids |
| | Phenylacetyl disulfide Usage And Synthesis |
| Uses | Bis(phenylacetyl)disulfide as sulfur substitution agent in preparation of RNA oligonucleotides. | | Uses | Phenylacetyl disulfide (PADS) may be used as a sulphur transfer agent during the synthesis of phosphorothioate oligodeoxyribonucleotides. | | General Description | Phenylacetyl disulphide serves as a sulfurization reagent during the preparation of phosphates.Phenyl acetyl disulfide can be synthesized by the reaction of phenyl benzenethiolsulfonate with thioacetic acid in the presence of triethylamine. |
| | Phenylacetyl disulfide Preparation Products And Raw materials |
|