|
|
| | 4-[(4-nitrobenzoyl)amino]benzoic acid Basic information |
| Product Name: | 4-[(4-nitrobenzoyl)amino]benzoic acid | | Synonyms: | 4-[(4-nitrobenzoyl)amino]benzoic acid;benzoic acid, 4-[(4-nitrobenzoyl)amino]-;4-[(4-nitrophenyl)carbonylamino]benzoic acid;4-[[(4-nitrophenyl)-oxomethyl]amino]benzoic acid;CBDivE_004412;EU-0035443;InChI=1/C14H10N2O5/c17-13(9-3-7-12(8-4-9)16(20)21)15-11-5-1-10(2-6-11)14(18)19/h1-8H,(H,15,17)(H,18,19;Oprea1_838457 | | CAS: | 19717-14-7 | | MF: | C14H10N2O5 | | MW: | 286.24 | | EINECS: | | | Product Categories: | | | Mol File: | 19717-14-7.mol | ![4-[(4-nitrobenzoyl)amino]benzoic acid Structure](CAS/GIF/19717-14-7.gif) |
| | 4-[(4-nitrobenzoyl)amino]benzoic acid Chemical Properties |
| Melting point | 326-327 °C | | Boiling point | 440.7±30.0 °C(Predicted) | | density | 1.485±0.06 g/cm3(Predicted) | | pka | 4.19±0.10(Predicted) |
| | 4-[(4-nitrobenzoyl)amino]benzoic acid Usage And Synthesis |
| | 4-[(4-nitrobenzoyl)amino]benzoic acid Preparation Products And Raw materials |
|