- Fmoc-D-Phg-OH
-
- $0.00/ kg
-
2026-05-09
- CAS:111524-95-9
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T
- FMOC-D-PHG-OH
-
- $7.00 / 1KG
-
2019-09-02
- CAS:111524-95-9
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: JD 353
|
| | FMOC-D-PHG-OH Basic information |
| | FMOC-D-PHG-OH Chemical Properties |
| Melting point | 170-180°C | | Boiling point | 606.3±50.0 °C(Predicted) | | density | 1.299±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | soluble in Methanol | | pka | 3.39±0.10(Predicted) | | form | Solid | | color | White to Light yellow | | Major Application | peptide synthesis | | InChI | 1S/C23H19NO4/c25-22(26)21(15-8-2-1-3-9-15)24-23(27)28-14-20-18-12-6-4-10-16(18)17-11-5-7-13-19(17)20/h1-13,20-21H,14H2,(H,24,27)(H,25,26)/t21-/m1/s1 | | InChIKey | PCJHOCNJLMFYCV-OAQYLSRUSA-N | | SMILES | N([C@H](c4ccccc4)C(=O)O)C(=O)OCC1c2c(cccc2)c3c1cccc3 | | CAS DataBase Reference | 111524-95-9(CAS DataBase Reference) |
| WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids |
| | FMOC-D-PHG-OH Usage And Synthesis |
| Chemical Properties | White powder | | Uses | Fmoc-d-phg-oh, is an amino acid derivative used in peptide chemistry. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | FMOC-D-PHG-OH Preparation Products And Raw materials |
|