|
|
| | 4-(METHYLTHIO)BENZOIC ACID Basic information | | Application |
| | 4-(METHYLTHIO)BENZOIC ACID Chemical Properties |
| Melting point | 192-196 °C(lit.) | | Boiling point | 319.0±25.0 °C(Predicted) | | density | 1.28±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | pka | 4.28±0.10(Predicted) | | color | White to Light yellow | | BRN | 2082809 | | InChI | InChI=1S/C8H8O2S/c1-11-7-4-2-6(3-5-7)8(9)10/h2-5H,1H3,(H,9,10) | | InChIKey | KWHCPERWLHBLOT-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(SC)C=C1 | | LogP | 2.740 | | CAS DataBase Reference | 13205-48-6(CAS DataBase Reference) |
| | 4-(METHYLTHIO)BENZOIC ACID Usage And Synthesis |
| Application | Benzoic acid compounds, such as 4-methylthiobenzoic acid, are widely used in the chemical industry, including food, medicine, and dyes. They are also an important intermediate in organic synthesis. | | Chemical Properties | light yellow to beige crystalline powder | | Uses | Administration of 4-(methylthio)benzoic acid reduces cisplatin nephrotoxicity in rats. It prevents in vitro DNA binding and mutation induction in Escherichia coli K12. | | General Description | Administration of 4-(methylthio)benzoic acid reduces cisplatin nephrotoxicity in rats. It prevents in vitro DNA binding and mutation induction in Escherichia coli K12. |
| | 4-(METHYLTHIO)BENZOIC ACID Preparation Products And Raw materials |
|