|
|
| | Methyl 2-[4-(bromomethyl)phenyl]benzoate Basic information |
| | Methyl 2-[4-(bromomethyl)phenyl]benzoate Chemical Properties |
| Melting point | 56 °C | | Boiling point | 412.8±38.0 °C(Predicted) | | density | 1.374±0.06 g/cm3(Predicted) | | vapor pressure | 0.001-0.002Pa at 20-25℃ | | storage temp. | Inert atmosphere,2-8°C | | solubility | soluble in Toluene | | form | Powder | | color | White to Light yellow | | InChI | InChI=1S/C15H13BrO2/c1-18-15(17)14-5-3-2-4-13(14)12-8-6-11(10-16)7-9-12/h2-9H,10H2,1H3 | | InChIKey | RMXGTMRDXKUUDJ-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(CBr)C=C2)=CC=CC=C1C(OC)=O | | CAS DataBase Reference | 114772-38-2(CAS DataBase Reference) |
| | Methyl 2-[4-(bromomethyl)phenyl]benzoate Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses |
Methyl 2-[4-(bromomethyl)phenyl]benzoate (cas# 114772-38-2) is a compound useful in organic synthesis used in the preparation and alkyalation of imidazoles.
|
| | Methyl 2-[4-(bromomethyl)phenyl]benzoate Preparation Products And Raw materials |
|