|
|
| | 1,4-Dihydroxy-2-naphthoic acid Basic information |
| | 1,4-Dihydroxy-2-naphthoic acid Chemical Properties |
| Melting point | 220 °C (dec.) (lit.) | | Boiling point | 461.7±40.0 °C(Predicted) | | density | 1.535±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 2.89±0.30(Predicted) | | form | powder to crystal | | color | White to Amber to Dark green | | Water Solubility | Slightly soluble in water. | | InChI | InChI=1S/C11H8O4/c12-9-5-8(11(14)15)10(13)7-4-2-1-3-6(7)9/h1-5,12-13H,(H,14,15) | | InChIKey | VOJUXHHACRXLTD-UHFFFAOYSA-N | | SMILES | C1(O)=C2C(C=CC=C2)=C(O)C=C1C(O)=O | | CAS DataBase Reference | 31519-22-9(CAS DataBase Reference) | | EPA Substance Registry System | 2-Naphthalenecarboxylic acid, 1,4-dihydroxy- (31519-22-9) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29182900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 1,4-Dihydroxy-2-naphthoic acid Usage And Synthesis |
| Chemical Properties | Lighte yellow powder | | Uses | 1,4-Dihydroxy-2-naphthoic acid from Propionibacterium freudenreichii is known to promote the proliferation of Bifidobacterium. It has potential therapeutic application for psoriasis treatment. | | Definition | ChEBI: A naphthoic acid that is 2-naphthoic acid substituted by hydroxy groups at positions 1 and 4. | | General Description | 1,4-Dihydroxy-2-naphthoic acid from Propionibacterium freudenreichii is known to promote the proliferation of Bifidobacterium. It has potential therapeutic application for psoriasis treatment. |
| | 1,4-Dihydroxy-2-naphthoic acid Preparation Products And Raw materials |
|