N-Ethyl-3,4-(methylenedioxy)aniline manufacturers
|
| | N-Ethyl-3,4-(methylenedioxy)aniline Basic information |
| Product Name: | N-Ethyl-3,4-(methylenedioxy)aniline | | Synonyms: | n-ethyl-3-benzodioxol-5-amine;N-ethylbenzo-1,3-dioxol-5-amine;N-ETHYL-1,3-BENZODIOXOL-5-AMINE[FOR OXOLINIC ACID];3,4-METHYLENEDIOXY-N-ETHYLANILINE, 97+%;N-Ethyl-3,4-(methylenedioxy)aniline,99%;3,4-Methy;5-(Ethylamino)-1,3-benzodioxole
N-Ethyl-3,4-methylenedioxyaniline;N-Ethyl-3,4-methylenedioxyaniline 1,3-Benzodioxol-5-N-Ethylamine | | CAS: | 32953-14-3 | | MF: | C9H11NO2 | | MW: | 165.19 | | EINECS: | 251-302-6 | | Product Categories: | | | Mol File: | 32953-14-3.mol |  |
| | N-Ethyl-3,4-(methylenedioxy)aniline Chemical Properties |
| Boiling point | 101-103 °C (1 mmHg) | | density | 1,17 g/cm3 | | refractive index | 1.568-1.57 | | Fp | 110 °C | | storage temp. | 2-8°C | | pka | 5.71±0.20(Predicted) | | Water Solubility | slightly miscible | | InChI | InChI=1S/C9H11NO2/c1-2-10-7-3-4-8-9(5-7)12-6-11-8/h3-5,10H,2,6H2,1H3 | | InChIKey | FPKGTVXPIULTIP-UHFFFAOYSA-N | | SMILES | O1C2=CC=C(NCC)C=C2OC1 | | CAS DataBase Reference | 32953-14-3(CAS DataBase Reference) | | EPA Substance Registry System | 1,3-Benzodioxol-5-amine, N-ethyl- (32953-14-3) |
| Provider | Language |
|
ACROS
| English |
| | N-Ethyl-3,4-(methylenedioxy)aniline Usage And Synthesis |
| Chemical Properties | clear colorless to yellowish viscous liquid |
| | N-Ethyl-3,4-(methylenedioxy)aniline Preparation Products And Raw materials |
|