|
|
| | 6-Aza-spiro[3.4]octane Basic information |
| Product Name: | 6-Aza-spiro[3.4]octane | | Synonyms: | 6-Aza-spiro[3.4]octane;6-Aza-spiro[3.4]octane ox...;6-Aza-spiro[3.4]octane heMioxalate;6-Aza-spiro[3.4]octane oxalate;7-Azaspiro[3.4]octane;6-Azaspiro[3.4]octane HCl;7-Azaspiro[3.4]octane hemioxalate;6-Aza-spiro[3.4]octane - A7181 | | CAS: | 765-64-0 | | MF: | C7H13N | | MW: | 111.18 | | EINECS: | | | Product Categories: | | | Mol File: | 765-64-0.mol | ![6-Aza-spiro[3.4]octane Structure](CAS/GIF/765-64-0.gif) |
| | 6-Aza-spiro[3.4]octane Chemical Properties |
| Boiling point | 162.0±8.0 °C(Predicted) | | density | 0.96±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 11.41±0.20(Predicted) | | form | liquid | | color | Colourless | | InChI | InChI=1S/C7H13N/c1-2-7(3-1)4-5-8-6-7/h8H,1-6H2 | | InChIKey | NVZWMJWMTWOVNJ-UHFFFAOYSA-N | | SMILES | C1C2(CCNC2)CC1 |
| | 6-Aza-spiro[3.4]octane Usage And Synthesis |
| Uses | 6-Azaspiro[3.4]octane Hemioxalate is the Hemioxalate salt of 6-Azaspiro[3.4]octane, a reactant in the preparation of tetrahydroisoquinolin derivatives as CXCR3 receptor agonists. |
| | 6-Aza-spiro[3.4]octane Preparation Products And Raw materials |
|