- Bromomaleic anhydride
-
- $1.00 / 1g
-
2020-01-13
- CAS:5926-51-2
- Min. Order: 1g
- Purity: Min98%
- Supply Ability: g/kg/ton
|
| | BROMOMALEIC ANHYDRIDE Basic information |
| | BROMOMALEIC ANHYDRIDE Chemical Properties |
| Boiling point | 215 °C(lit.) | | density | 1.905 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.54(lit.) | | Fp | >230 °F | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | Appearance | Colorless to light yellow Solid-liquid mixture | | InChI | InChI=1S/C4HBrO3/c5-2-1-3(6)8-4(2)7/h1H | | InChIKey | YPRMWCKXOZFJGF-UHFFFAOYSA-N | | SMILES | O1C(=O)C=C(Br)C1=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HS Code | 29171990 |
| | BROMOMALEIC ANHYDRIDE Usage And Synthesis |
| Chemical Properties | Pale red liquid | | Uses | 3-Bromofuran-2,5-dione is used to study reversible or permanent chemical modification of proteins and peptides by control of maleimide hydrolysis. |
| | BROMOMALEIC ANHYDRIDE Preparation Products And Raw materials |
|