|
|
| | BNPS-SKATOLE Basic information |
| Product Name: | BNPS-SKATOLE | | Synonyms: | 2-(2-Nitrophenylsulfenyl)-3-methyl-3-bromoindolenine, 3-Bromo-3-methyl-2-(2-nitrophenylmercapto)-3H-indole, BNPS-skatol;2-(2-Nitrophenylsulfenyl)-3-methyl-3-bromo-3H-indole;3H-Indole, 3-bromo-3-methyl-2-((2-nitrophenyl)thio)-;Einecs 248-737-9;Nsc 240875;3-bromo-3-methyl-2-(2-nitrophenyl)sulfanylindole;BROMO-3-METHYL-2-(2-NITROPHENYLMERCAPTO)-3H-INDOLE;BNPS-SKATOL | | CAS: | 27933-36-4 | | MF: | C15H11BrN2O2S | | MW: | 363.23 | | EINECS: | 248-737-9 | | Product Categories: | proteinmod | | Mol File: | 27933-36-4.mol |  |
| | BNPS-SKATOLE Chemical Properties |
| Boiling point | 448.8±45.0 °C(Predicted) | | density | 1.57±0.1 g/cm3(Predicted) | | storage temp. | −20°C | | pka | 2.45±0.40(Predicted) | | InChI | InChI=1S/C15H11BrN2O2S/c1-15(16)10-6-2-3-7-11(10)17-14(15)21-13-9-5-4-8-12(13)18(19)20/h2-9H,1H3 | | InChIKey | BXTVQNYQYUTQAZ-UHFFFAOYSA-N | | SMILES | N1C2=C(C=CC=C2)C(Br)(C)C=1SC1=CC=CC=C1[N+]([O-])=O |
| Safety Statements | 24/25 | | WGK Germany | 3 | | F | 10 | | HS Code | 2933998090 |
| | BNPS-SKATOLE Usage And Synthesis |
| Definition | ChEBI: A bromoindole that is 3H-indole in which the hydrogen at position 2 has been replaced by an (o-nitrophenyl)sulfanyl group and in which the hydrogens at position 3 have been replaced by a bromine and a methyl group. It is use
particularly for the selective cleavage of tryptophanyl peptide bonds (cleavage occurs at peptide bonds after amino acids with available Cgamma2Cdelta double bonds su
h as tryptophan, tyrosine, and histidine). |
| | BNPS-SKATOLE Preparation Products And Raw materials |
|