- Dansyl Acid
-
- $0.00 / 1KG
-
2020-02-26
- CAS: 4272-77-9
- Min. Order: 1KG
- Purity: 99.0%+
- Supply Ability: 100 tons
|
| | 5-(Dimethylamino)-1-naphthalenesulfonic acid Basic information |
| | 5-(Dimethylamino)-1-naphthalenesulfonic acid Chemical Properties |
| Melting point | 316 °C | | density | 1.363±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Methanol (Slightly, Heated) | | form | Solid | | pka | -0.22±0.40(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C12H13NO3S/c1-13(2)11-7-3-6-10-9(11)5-4-8-12(10)17(14,15)16/h3-8H,1-2H3,(H,14,15,16) | | InChIKey | USWNUPFIMWECBM-UHFFFAOYSA-N | | SMILES | C1(S(O)(=O)=O)=C2C(C(N(C)C)=CC=C2)=CC=C1 | | EPA Substance Registry System | 1-Naphthalenesulfonic acid, 5-(dimethylamino)- (4272-77-9) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | F | 10 | | TSCA | TSCA listed | | HS Code | 29214990 |
| | 5-(Dimethylamino)-1-naphthalenesulfonic acid Usage And Synthesis |
| Chemical Properties | 5-(Dimethylamino)-1-naphthalenesulfonic acid is white to off-white or beige-greyish powder | | Uses | 5-(Dimethylamino)-1-naphthalenesulfonic acid is a fluorescent molecule used in protein analysis and FRET detection. |
| | 5-(Dimethylamino)-1-naphthalenesulfonic acid Preparation Products And Raw materials |
|