- Prohexadione calcium
-
- $0.00 / 1KG
-
2026-04-21
- CAS:127277-53-6
- Min. Order: 1KG
- Purity: 98.0%
- Supply Ability: 1000kg/month
|
| | Prohexadione calcium Basic information |
| Product Name: | Prohexadione calcium | | Synonyms: | PROHEXADIONE-CALCIUM;kuh-833;3,5-dioxo-4-propionylcy-clohexanecarboxylic scid;3,5-Dioxo-4-(1-oxopropyl)cyclohexanecarboxylic acid ion(1-) calcium, calcium salt;Apogee;Bas 125;Bas 125w;Calcium 3-oxido-5-oxo-4-propionylcyclohex-3-enecarboxylate (iupac) | | CAS: | 127277-53-6 | | MF: | C10H13Ca2O5+ | | MW: | 293.36 | | EINECS: | 200-001-8 | | Product Categories: | | | Mol File: | 127277-53-6.mol |  |
| | Prohexadione calcium Chemical Properties |
| Melting point | >360° | | storage temp. | 0-6°C | | form | Solid | | color | Off-white to light yellow | | Henry's Law Constant | 5.2×104 mol/(m3Pa) at 25℃, Maniere et al. (2011) | | Major Application | agriculture
environmental | | InChI | InChI=1S/C10H11O5.2Ca.2H/c1-2-6(11)9-7(12)3-5(10(14)15)4-8(9)13;;;;/h5H,2-4H2,1H3,(H,14,15);;;;/q-1;;+2;; | | InChIKey | MRNFLMSOYSDUNU-UHFFFAOYSA-N | | SMILES | C([C-]1C(CC(C(=O)O)CC1=O)=O)(=O)CC.[Ca+2].[Ca] | | EPA Substance Registry System | Prohexadione calcium (127277-53-6) |
| WGK Germany | 2 | | RTECS | GU8488500 | | Storage Class | 11 - Combustible Solids | | Hazardous Substances Data | 127277-53-6(Hazardous Substances Data) | | Toxicity | LD50 in rats (mg/kg): >5000 orally; >2000 dermally; LC50 in carp, bluegill sunfish, rainbow trout (mg/l): >150, >100, >100 (Miyazawa) |
| | Prohexadione calcium Usage And Synthesis |
| Description | Prohexadione-Calcium (Pro-Ca, prohexadione-Ca or BX-112) is a plant growth retardant which is used to inhibit gibberellin biosynthesis of plants. It generally reduces shoot elongation in plants. | | Uses | Prohexadione Calcium is a plant growth regulator. | | Uses | Prohexadione calcium is plant growth regulator. | | Definition | ChEBI: Prohexadione-calcium is a calcium salt containing equal numbers of prohexadione(2-) and Ca(2+) ions. A plant growth regulator, it is used as an anti-lodging agent in small-grain cereals. It has a role as a plant growth regulator, an agrochemical and a gibberellin biosynthesis inhibitor. It contains a prohexadione(2-). | | Agricultural Uses | Prohexadione calcium is used to inhibit foliar growth on apples and pears, reduces maturation of fruit and foliar covering. Also used on turf grass. | | Trade name | APOGEE® PLANT GROWTH REGULATOR; BASELINE® PLANT REGULATOR; BX 112®; K-I CHEMICAL; KIM-112®; KUH-833®; VIVIFUL® |
| | Prohexadione calcium Preparation Products And Raw materials |
|