- L-Menthyl lactate
-
- $0.00 / 1KG
-
2025-06-27
- CAS:61597-98-6
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 500000kg
- L-Menthyl lactate
-
- $0.00 / 1kg
-
2025-06-20
- CAS:61597-98-6
- Min. Order: 1kg
- Purity: 0.99
- Supply Ability: 20 tons
- L-Menthyl lactate
-
- $32.00/ kg
-
2025-04-15
- CAS:61597-98-6
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 5000kg/week
|
| | L-Menthyl lactate Basic information |
| Product Name: | L-Menthyl lactate | | Synonyms: | L-MENTHYL LACTATE 97+%;L-Menthyl lactate;L-(-)-Menthyl L-Lactate;(1R,2S,5R)-2-Isopropyl-5-Methylcyclohexyl (S)-2-Hydroxypropionate;(1R,2S,5R)-2-Isopropyl-5-methylcyclohexyl (S)-2-Hydroxypropionate;L-Menthyl lactate（N）;(1R,2S,5R)-2-Isopropyl-5-methylcyclohexyl(S)-2-Hydroxypropionate>;Propanoic acid, 2-hydroxy-, (1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl ester, (2S)- | | CAS: | 61597-98-6 | | MF: | C13H24O3 | | MW: | 228.33 | | EINECS: | 612-179-8 | | Product Categories: | Alphabetical Listings;Flavors and Fragrances;M-N | | Mol File: | 61597-98-6.mol |  |
| | L-Menthyl lactate Chemical Properties |
| Melting point | 42-47 °C(lit.) | | alpha | -81 º (c=5,EtOH) | | Boiling point | 142 °C5 mm Hg(lit.) | | density | 0.99±0.1 g/cm3(Predicted) | | vapor pressure | 0.003-0.007Pa at 20℃ | | FEMA | 3748 | L-MENTHYL LACTATE | | Fp | >230 °F | | storage temp. | Store at room temperature | | pka | 13.01±0.20(Predicted) | | form | Viscous | | color | White to Almost white | | λmax | 233nm(CH2Cl2)(lit.) | | JECFA Number | 433 | | InChI | InChI=1S/C13H24O3/c1-8(2)11-6-5-9(3)7-12(11)16-13(15)10(4)14/h8-12,14H,5-7H2,1-4H3/t9-,10+,11+,12-/m1/s1 | | InChIKey | UJNOLBSYLSYIBM-NOOOWODRSA-N | | SMILES | C(O[C@@H]1C[C@H](C)CC[C@H]1C(C)C)(=O)[C@@H](O)C | | LogP | 3.629-3.641 at 25℃ and pH5.68-7.05 |
| WGK Germany | 3 | | HS Code | 2918.11.5100 |
| | L-Menthyl lactate Usage And Synthesis |
| Chemical Properties | white crystal powde | | Uses | L-Menthyl Lactate is used in preparation of amides for generating a trigeminal sensory effect. |
| | L-Menthyl lactate Preparation Products And Raw materials |
|