|
|
| | 4-Bromo-3-fluorobenzenesulfonamide Basic information |
| | 4-Bromo-3-fluorobenzenesulfonamide Chemical Properties |
| Melting point | 137-141 °C (lit.) | | Boiling point | 360.1±52.0 °C(Predicted) | | density | 1.830±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | pka | 9.68±0.60(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C6H5BrFNO2S/c7-5-2-1-4(3-6(5)8)12(9,10)11/h1-3H,(H2,9,10,11) | | InChIKey | QTICZSSQSQDJEX-UHFFFAOYSA-N | | SMILES | C1(S(N)(=O)=O)=CC=C(Br)C(F)=C1 | | CAS DataBase Reference | 263349-73-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 22-36/37/38 | | Safety Statements | 22-36/37-37-26 | | WGK Germany | 3 | | Hazard Note | Irritant | | PackingGroup | I | | HS Code | 29350090 | | Storage Class | 11 - Combustible Solids |
| | 4-Bromo-3-fluorobenzenesulfonamide Usage And Synthesis |
| | 4-Bromo-3-fluorobenzenesulfonamide Preparation Products And Raw materials |
|