|
|
| | 4-Benzofurazancarboxaldehyde Basic information |
| Product Name: | 4-Benzofurazancarboxaldehyde | | Synonyms: | 2,1,3-Benzoxadiazole-4-carboxaldehyde (9CI);2,1,3-BENZOXADIAZOLE-4-CARBOXALDEHYDE;2,1,3-Benzoxadiazole-4-carbaldehyde;4-Benzofurazone Carboxaldehyde;2,1,3-Benzoxadiazole-4-aldehyde;Benzofurazon-4-Carboxaldehyde;4-FORMYL-BENZO[C][1,2,5]OXADIAZOLE;4-Benzofurazancarboxaldehyde ,97% | | CAS: | 32863-32-4 | | MF: | C7H4N2O2 | | MW: | 148.12 | | EINECS: | 682-565-9 | | Product Categories: | Aromatics;Heterocycles;Intermediates & Fine Chemicals;Pharmaceuticals;ALDEHYDE | | Mol File: | 32863-32-4.mol |  |
| | 4-Benzofurazancarboxaldehyde Chemical Properties |
| Melting point | 100-102°C | | Boiling point | 277 °C | | density | 1.417 | | Fp | 121 °C | | storage temp. | Inert atmosphere,2-8°C | | solubility | Dichloromethane (Slightly), Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | -1.86±0.45(Predicted) | | color | Light Brown | | InChI | InChI=1S/C7H4N2O2/c10-4-5-2-1-3-6-7(5)9-11-8-6/h1-4H | | InChIKey | YBBRQAXNTWMMFZ-UHFFFAOYSA-N | | SMILES | N1=C2C=CC=C(C=O)C2=NO1 |
| | 4-Benzofurazancarboxaldehyde Usage And Synthesis |
| Chemical Properties | Light Brown Solid | | Uses | A synthetic intermediate for the production of Isradipine. | | Synthesis | General procedure for the synthesis of benzodiazole-4-carbaldehyde from 4-(bromomethyl)benzo[c][1,2,5]oxadiazole: 4-(bromomethyl)benzo[c][1,2,5]oxadiazole (19.7 g, 0.1 mol), dimethylsulfoxide (DMSO, 15 mL), and sodium bicarbonate (10 g, 0.12 mol) were added to the reaction flask sequentially. The reaction mixture was heated to 100-150 °C under nitrogen protection. Upon completion of the reaction, the mixture was cooled to room temperature and subsequently extracted with deionized water and ethyl acetate. The organic layers were combined and washed with saturated sodium chloride solution. The organic layer was dried over anhydrous sodium sulfate and concentrated under reduced pressure to remove the solvent to give 10.6 g of a light yellow solid product in 71.6% yield with a melting point of 108-109 °C. | | References | [1] Patent: CN102285978, 2016, B. Location in patent: Paragraph 0031
[2] European Journal of Medicinal Chemistry, 1996, vol. 31, # 1, p. 3 - 10 |
| | 4-Benzofurazancarboxaldehyde Preparation Products And Raw materials |
|